The IUPAC name of following compound is : CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH

Question

Accepted Answer

The compound given is CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH. To determine the correct IUPAC name, we need to analyze the structure and functional groups present in the compound.

1. **Explanation for Option 2: 5-oxohexanoic acid**
   - The compound has a total of six carbon atoms in the longest continuous chain, which corresponds to "hexanoic acid."
   - The presence of a carboxylic acid group (-COOH) at the end of the chain confirms the "hexanoic acid" part of the name.
   - There is a ketone group (C=O) located on the fifth carbon of the chain, which is indicated by "5-oxo."
   - Therefore, the correct IUPAC name for the compound is "5-oxohexanoic acid," which matches Option 2.

2. **Explanation for why other options are incorrect:**

- **Option 1: 6-carboxy hexan-2-one**
     - This option suggests a carboxylic acid group at the sixth position and a ketone at the second position. However, the compound has a carboxylic acid group at the end of the chain, not at the sixth position, and the ketone is at the fifth position, not the second. Therefore, this option does not accurately describe the structure of the compound.

- **Option 3: Butyl methyl ketone**
     - This name implies a ketone with a butyl group and a methyl group attached to the carbonyl carbon. The compound in question has a carboxylic acid group and a ketone, not a simple ketone with butyl and methyl groups. Thus, this option does not fit the structure of the compound.

- **Option 4: 1,5-diketohexanol**
     - This option suggests two ketone groups and an alcohol group. The compound has one ketone group and two carboxylic acid groups, not an alcohol group. Therefore, this option is incorrect for the given compound.

In conclusion, Option 2, "5-oxohexanoic acid," is the correct IUPAC name for the compound, as it accurately describes the structure with a ketone group at the fifth position and a carboxylic acid group at the end of the six-carbon chain.