HTET Exam - Level 1 Prt - Carbon And Its Compounds

Explanation:

1. Coal (Option 1): Coal is not a crystalline allotrope of carbon. It is an amorphous form of carbon, meaning it lacks a well-defined crystalline structure. Coal is primarily composed of carbon, but it also contains other elements such as hydrogen, sulfur, oxygen, and nitrogen. Its structure is disordered, which is characteristic of amorphous materials. This lack of a regular, repeating pattern distinguishes coal from crystalline allotropes of carbon.

2. Graphite (Option 2): Graphite is a crystalline allotrope of carbon. It has a layered structure where carbon atoms are arranged in a hexagonal lattice. These layers are held together by weak van der Waals forces, allowing them to slide over each other easily, which is why graphite is used as a lubricant and in pencils. The regular arrangement of carbon atoms in graphite qualifies it as a crystalline form of carbon.

3. Diamond (Option 3): Diamond is another crystalline allotrope of carbon. In diamond, each carbon atom is tetrahedrally bonded to four other carbon atoms, forming a very strong and rigid three-dimensional lattice. This structure gives diamond its renowned hardness and high refractive index. The orderly and repeating pattern of carbon atoms in diamond makes it a crystalline material.

4. Fullerene (Option 4): Fullerene is also a crystalline allotrope of carbon. Fullerenes are molecules composed entirely of carbon, taking the form of a hollow sphere, ellipsoid, or tube. The most well-known fullerene is buckminsterfullerene (C60), which resembles a soccer ball. The carbon atoms in fullerenes are arranged in a highly symmetrical and regular pattern, characteristic of crystalline structures.

In summary, coal is the only option that does not have a crystalline structure, making it the correct answer as the non-crystalline allotrope of carbon. Graphite, diamond, and fullerene all have well-defined crystalline structures, distinguishing them from coal.

कोल (कोयला) कार्बन का एक क्रिस्टलीय अपररूप नहीं है। कोल एक अमोर्फ (अक्रिस्टलीय) पदार्थ है, जिसका मतलब है कि इसमें कार्बन परमाणु किसी नियमित पैटर्न में व्यवस्थित नहीं होते हैं। इसके विपरीत, क्रिस्टलीय अपररूपों में कार्बन परमाणु एक निश्चित ज्यामितीय पैटर्न में व्यवस्थित होते हैं।

अब हम अन्य विकल्पों पर विचार करते हैं:

2. ग्रेफाइट: ग्रेफाइट कार्बन का एक क्रिस्टलीय अपररूप है। इसमें कार्बन परमाणु हेक्सागोनल लेयर में व्यवस्थित होते हैं, जो एक-दूसरे के ऊपर स्लाइड कर सकते हैं। यह इसकी चिकनाई का कारण है।

3. डायमण्ड: डायमण्ड भी कार्बन का एक क्रिस्टलीय अपररूप है। इसमें कार्बन परमाणु एक टेट्राहेड्रल संरचना में होते हैं, जो इसे अत्यधिक कठोर बनाता है।

4. फुलरीन: फुलरीन कार्बन का एक क्रिस्टलीय अपररूप है, जिसमें कार्बन परमाणु एक गोलाकार संरचना में होते हैं। यह एक विशेष प्रकार का क्रिस्टलीय रूप है।

इस प्रकार, कोल (कोयला) कार्बन का एक क्रिस्टलीय अपररूप नहीं है, जबकि ग्रेफाइट, डायमण्ड, और फुलरीन सभी क्रिस्टलीय अपररूप हैं। इसलिए, सही उत्तर विकल्प 1 है।

Option 2, Butene-2, is the correct answer because it will give the same product when treated with HBr in the presence and absence of peroxide. This is due to the nature of the reaction mechanism involved.

1. Explanation for Option 2 (Butene-2):

   • Butene-2 is a symmetrical alkene, meaning that the double bond is located between two identical groups (CH3-CH=CH-CH3). When HBr is added to Butene-2, the reaction follows Markovnikov's rule in the absence of peroxide, leading to the formation of 2-bromobutane. In the presence of peroxide, the reaction follows the anti-Markovnikov rule due to the free radical mechanism, but since Butene-2 is symmetrical, the product remains the same, 2-bromobutane. Thus, in both scenarios, the product is identical.

2. Explanation for why other options are incorrect:

   • Option 1 (Propene):

     • Propene is an asymmetrical alkene. In the absence of peroxide, HBr adds according to Markovnikov's rule, resulting in 2-bromopropane. In the presence of peroxide, the addition follows the anti-Markovnikov rule, leading to 1-bromopropane. Therefore, the products are different in the presence and absence of peroxide.

   • Option 3 (2-methyl propene):

     • 2-methyl propene is also an asymmetrical alkene. Without peroxide, HBr adds according to Markovnikov's rule, forming tert-butyl bromide. With peroxide, the addition follows the anti-Markovnikov rule, resulting in isobutyl bromide. Thus, the products differ in the presence and absence of peroxide.

   • Option 4 (Butene-1):

     • Butene-1 is an asymmetrical alkene. In the absence of peroxide, HBr adds according to Markovnikov's rule, producing 2-bromobutane. In the presence of peroxide, the reaction follows the anti-Markovnikov rule, yielding 1-bromobutane. Therefore, the products are not the same in both conditions.

In conclusion, Butene-2 is the only alkene among the options that produces the same product, 2-bromobutane, regardless of whether the reaction is carried out in the presence or absence of peroxide. This is due to its symmetrical structure, which leads to identical products under both reaction conditions.

ब्यूटीन-2 (Option 2) को HBr के साथ परऑक्साइड की उपस्थिति और अनुपस्थिति में समान उत्पाद देने के लिए सही विकल्प माना गया है। आइए इसे विस्तार से समझते हैं:

1. ब्यूटीन-2 (Option 2): ब्यूटीन-2 एक आंतरिक एल्कीन है, जिसका मतलब है कि डबल बॉन्ड कार्बन श्रृंखला के बीच में स्थित है। जब ब्यूटीन-2 HBr के साथ प्रतिक्रिया करता है, तो परऑक्साइड की उपस्थिति में एंटी-मार्कोवनीकोव नियम के अनुसार प्रतिक्रिया होती है, और अनुपस्थिति में मार्कोवनीकोव नियम के अनुसार। हालांकि, ब्यूटीन-2 के मामले में, दोनों स्थितियों में उत्पाद समान होता है क्योंकि दोनों कार्बन पर समान प्रकार के हाइड्रोजन होते हैं, जिससे कोई प्राथमिकता नहीं होती है। इसलिए, ब्यूटीन-2 HBr के साथ परऑक्साइड की उपस्थिति और अनुपस्थिति में समान उत्पाद देता है।

2. प्रोपीन (Option 1): प्रोपीन एक टर्मिनल एल्कीन है। HBr के साथ परऑक्साइड की अनुपस्थिति में, यह मार्कोवनीकोव नियम के अनुसार प्रतिक्रिया करता है, जिससे ब्रोमोप्रोपेन बनता है। परऑक्साइड की उपस्थिति में, एंटी-मार्कोवनीकोव नियम के अनुसार प्रतिक्रिया होती है, जिससे 1-ब्रोमोप्रोपेन बनता है। इसलिए, उत्पाद अलग-अलग होते हैं।

3. 2-मिथाइल प्रोपीन (Option 3): यह भी एक टर्मिनल एल्कीन है। HBr के साथ परऑक्साइड की अनुपस्थिति में, यह मार्कोवनीकोव नियम के अनुसार प्रतिक्रिया करता है, जबकि परऑक्साइड की उपस्थिति में एंटी-मार्कोवनीकोव नियम के अनुसार। इस कारण से, उत्पाद अलग-अलग होते हैं।

4. ब्यूटीन-1 (Option 4): ब्यूटीन-1 भी एक टर्मिनल एल्कीन है। HBr के साथ परऑक्साइड की अनुपस्थिति में, यह मार्कोवनीकोव नियम के अनुसार प्रतिक्रिया करता है, जबकि परऑक्साइड की उपस्थिति में एंटी-मार्कोवनीकोव नियम के अनुसार। इस कारण से, उत्पाद अलग-अलग होते हैं।

इस प्रकार, ब्यूटीन-2 (Option 2) ही एकमात्र ऐसा विकल्प है जो HBr के साथ परऑक्साइड की उपस्थिति और अनुपस्थिति में समान उत्पाद देता है।

Elimination of HBr from 2-bromobutane is a classic example of a dehydrohalogenation reaction, which typically follows the Zaitsev's rule. According to Zaitsev's rule, the more substituted alkene is generally the major product in elimination reactions. This is because more substituted alkenes are more stable due to hyperconjugation and the inductive effect.

1. Explanation for Option 2 (Predominantly 2-butene):

   • In the elimination of HBr from 2-bromobutane, the base abstracts a proton from the β-carbon that has the fewest hydrogens, leading to the formation of the more substituted alkene. In this case, the removal of a hydrogen from the carbon adjacent to the carbon bearing the bromine atom results in the formation of 2-butene.
   • 2-butene is more stable than 1-butene because it is a more substituted alkene. It has two alkyl groups attached to the double-bonded carbons, which stabilize the double bond through hyperconjugation and the inductive effect.
   • Therefore, the reaction predominantly yields 2-butene, making Option 2 the correct answer.

2. Explanation for why other options are incorrect:

   • Option 1 (Equimolar mixture of 1- and 2-butene): This option is incorrect because the reaction does not produce an equimolar mixture. The Zaitsev's rule predicts that the more substituted alkene (2-butene) will be the major product, not an equal mixture.
   • Option 3 (Predominantly 1-butene): This option is incorrect because 1-butene is the less substituted and less stable alkene compared to 2-butene. According to Zaitsev's rule, the reaction favors the formation of the more substituted alkene, which is 2-butene.
   • Option 4 (Predominantly 2-butyne): This option is incorrect because the reaction involves the elimination of HBr to form an alkene, not an alkyne. The formation of an alkyne would require a different set of conditions and reagents, which are not present in this reaction.

In conclusion, the elimination of HBr from 2-bromobutane predominantly results in the formation of 2-butene due to the stability provided by the more substituted double bond, in accordance with Zaitsev's rule. This supports Option 2 as the correct answer.

2-ब्रोमोब्यूटेन में से HBr के विलोपन से मुख्यतः 2-ब्यूटीन बनता है। यह प्रतिक्रिया एक प्रकार की एलिमिनेशन रिएक्शन है, जिसे E2 रिएक्शन कहा जाता है। इस प्रक्रिया में, 2-ब्रोमोब्यूटेन से HBr का विलोपन होता है, जिससे एक डबल बॉन्ड बनता है और अल्कीन का निर्माण होता है।

1. मुख्यतः 2-ब्यूटीन बनने का कारण:

   • 2-ब्रोमोब्यूटेन में ब्रोमाइन समूह द्वितीय कार्बन पर स्थित होता है। जब HBr का विलोपन होता है, तो यह प्रक्रिया ज़ैत्सेव के नियम का पालन करती है, जो कहता है कि अधिक स्थिर और अधिक सब्स्टिट्यूटेड अल्कीन प्राथमिकता से बनेगा। 2-ब्यूटीन अधिक सब्स्टिट्यूटेड है और इसलिए अधिक स्थिर है, इसीलिए यह मुख्य उत्पाद के रूप में बनता है।

2. अन्य विकल्पों का खंडन:

   • विकल्प 1 (1- व 2-ब्यूटीन का समआण्विक मिश्रण): यद्यपि कुछ मात्रा में 1-ब्यूटीन भी बन सकता है, लेकिन ज़ैत्सेव के नियम के अनुसार, 2-ब्यूटीन प्रमुख उत्पाद होता है। इसलिए, यह विकल्प सही नहीं है।
   • विकल्प 3 (मुख्यतः 1-ब्यूटीन): 1-ब्यूटीन कम सब्स्टिट्यूटेड और कम स्थिर होता है, इसलिए यह मुख्य उत्पाद नहीं बनता। ज़ैत्सेव के नियम के अनुसार, अधिक सब्स्टिट्यूटेड अल्कीन (2-ब्यूटीन) प्राथमिकता से बनता है।
   • विकल्प 4 (मुख्यतः 2-ब्यूटाइन): 2-ब्यूटाइन एक अल्काइन है, और HBr के विलोपन से अल्कीन बनता है, न कि अल्काइन। इसलिए, यह विकल्प गलत है।

इस प्रकार, 2-ब्रोमोब्यूटेन से HBr के विलोपन के परिणामस्वरूप मुख्यतः 2-ब्यूटीन का निर्माण होता है, जो विकल्प 2 को सही ठहराता है।

To determine the correct alkene that, upon ozonolysis followed by hydrolysis, yields 2-pentanone and ethanal, we need to analyze the structure of each option and the products formed.

Explanation for Option 4: 3-methyl-2-hexene

Ozonolysis Process:

1. 3-methyl-2-hexene has the structure:
   [
   \text{CH}_3-\text{CH}(\text{CH}_3)-\text{CH}=\text{CH}-\text{CH}_2-\text{CH}_3
   ]
2. During ozonolysis, the double bond is cleaved, and each carbon of the double bond is converted into a carbonyl group.
3. The cleavage of the double bond in 3-methyl-2-hexene results in the formation of two fragments:
   • One fragment is (\text{CH}_3-\text{C}(\text{O})-\text{CH}_2-\text{CH}_3) (2-pentanone)
   • The other fragment is (\text{CH}_3-\text{C}(\text{O})\text{H}) (ethanal)

This matches the products given in the question, confirming that 3-methyl-2-hexene is the correct alkene.

Explanation for Why Other Options are Incorrect

1. Option 1: 4-methyl-4-hexene

   • Structure: (\text{CH}_3-\text{CH}_2-\text{C}(\text{CH}_3)=\text{C}(\text{CH}_3)-\text{CH}_2-\text{CH}_3)
   • Ozonolysis would yield two identical ketones, not 2-pentanone and ethanal.

2. Option 2: 2-methyl-3-hexene

   • Structure: (\text{CH}_3-\text{CH}_2-\text{CH}(\text{CH}_3)=\text{CH}-\text{CH}_2-\text{CH}_3)
   • Ozonolysis would result in different products, specifically a ketone and an aldehyde that do not match 2-pentanone and ethanal.

3. Option 3: 2-propyl-2-butene

   • Structure: (\text{CH}_3-\text{CH}_2-\text{C}(\text{CH}_2\text{CH}_2\text{CH}_3)=\text{CH}_2)
   • Ozonolysis would yield a ketone and an aldehyde, but not the specific combination of 2-pentanone and ethanal.

In conclusion, only 3-methyl-2-hexene (Option 4) produces the exact combination of 2-pentanone and ethanal upon ozonolysis and hydrolysis, making it the correct answer.

एल्कीन की ओजोनोलिसिस प्रतिक्रिया के बाद जल अपघटन से प्राप्त यौगिकों के आधार पर सही एल्कीन की पहचान की जाती है। प्रश्न में दिए गए यौगिक 2-पेन्टेनोन और एथेनैल हैं।

अब, हम देखते हैं कि 3-मेथिल-2-हेक्सीन (विकल्प 4) का ओजोनोलिसिस करने पर कौन से यौगिक बनते हैं:

1. 3-मेथिल-2-हेक्सीन का संरचना सूत्र है:
   [
   CH_3-CH(CH_3)-CH=CH-CH_2-CH_3
   ]

2. ओजोनोलिसिस के बाद, डबल बॉन्ड के स्थान पर ऑक्सीजन के साथ दो कार्बोनिल यौगिक बनते हैं। 3-मेथिल-2-हेक्सीन के ओजोनोलिसिस से 2-पेन्टेनोन और एथेनैल बनते हैं।

3. 2-पेन्टेनोन का संरचना सूत्र है:
   [
   CH_3-CH_2-CO-CH_2-CH_3
   ]

4. एथेनैल का संरचना सूत्र है:
   [
   CH_3-CHO
   ]

इस प्रकार, 3-मेथिल-2-हेक्सीन का ओजोनोलिसिस 2-पेन्टेनोन और एथेनैल देता है, जो प्रश्न में दिए गए यौगिकों के साथ मेल खाता है। इसलिए, विकल्प 4 सही है।

अब अन्य विकल्पों की गलतियों को देखते हैं:

1. 4-मेथिल-4-हेक्सीन (विकल्प 1): इसका ओजोनोलिसिस करने पर 2-पेन्टेनोन और एथेनैल नहीं बनते। यह अन्य कार्बोनिल यौगिक देगा।

2. 2-मेथिल-3-हेक्सीन (विकल्प 2): इसका ओजोनोलिसिस करने पर भी 2-पेन्टेनोन और एथेनैल नहीं बनते। यह भी अन्य कार्बोनिल यौगिक देगा।

3. 2-प्रोपिल-2-ब्यूटीन (विकल्प 3): इसका ओजोनोलिसिस करने पर 2-पेन्टेनोन और एथेनैल नहीं बनते। यह भी अन्य कार्बोनिल यौगिक देगा।

इस प्रकार, 3-मेथिल-2-हेक्सीन (विकल्प 4) ही सही उत्तर है क्योंकि यह ओजोनोलिसिस के बाद 2-पेन्टेनोन और एथेनैल देता है।

To determine why Option 1, 2-Methyl Propene, is the correct answer for the ozonolysis reaction that yields propan-2-one and methanal, let's analyze the process of ozonolysis and the structure of the given alkenes.

Explanation for Option 1: 2-Methyl Propene

1. Structure of 2-Methyl Propene:

   • 2-Methyl Propene is an alkene with the structure CH3-C(CH3)=CH2. It has a double bond between the second and third carbon atoms.

2. Ozonolysis Reaction:

   • Ozonolysis involves the cleavage of the carbon-carbon double bond by ozone (O3), followed by reductive workup, typically with zinc and water, to yield carbonyl compounds.
   • For 2-Methyl Propene, the double bond between the second and third carbon atoms is cleaved. This results in the formation of two fragments:
     • One fragment is acetone (propan-2-one), CH3-CO-CH3, derived from the carbon atoms 1 and 2.
     • The other fragment is formaldehyde (methanal), H-CHO, derived from the carbon atom 3.

3. Conclusion:

   • The ozonolysis of 2-Methyl Propene perfectly matches the products given in the question: propan-2-one and methanal. Therefore, Option 1 is the correct answer.

Explanation for Why Other Options are Incorrect

1. Option 2: But-1-ene:

   • Structure: CH2=CH-CH2-CH3
   • Ozonolysis of But-1-ene would yield two molecules of ethanal (acetaldehyde), CH3-CHO, not propan-2-one and methanal.

2. Option 3: Propene:

   • Structure: CH2=CH-CH3
   • Ozonolysis of Propene would yield one molecule of ethanal (CH3-CHO) and one molecule of formaldehyde (H-CHO), not propan-2-one.

3. Option 4: But-2-ene:

   • Structure: CH3-CH=CH-CH3
   • Ozonolysis of But-2-ene would yield two molecules of acetone (propan-2-one), not methanal.

In summary, the ozonolysis of 2-Methyl Propene is the only reaction that produces the specified products, propan-2-one and methanal, confirming that Option 1 is indeed the correct answer.

2-मेथिल प्रोपीन का ओजोनी अपघटन प्रोपेन-2-ओन और मेथनैल देता है। आइए इसे विस्तार से समझते हैं:

1. 2-मेथिल प्रोपीन (Option 1):

   • 2-मेथिल प्रोपीन का रासायनिक संरचना CH3-C(CH3)=CH2 है।
   • जब इसका ओजोनी अपघटन होता है, तो यह दो भागों में टूटता है: एक भाग प्रोपेन-2-ओन (CH3-CO-CH3) बनाता है और दूसरा भाग मेथनैल (HCHO) बनाता है।
   • यह प्रतिक्रिया ओजोनोलिसिस की प्रक्रिया के अनुसार होती है, जहां डबल बॉन्ड के दोनों कार्बन परमाणु ऑक्सीजन के साथ जुड़कर कार्बोनिल यौगिक बनाते हैं।

2. ब्यूट-1-ईन (Option 2):

   • ब्यूट-1-ईन का रासायनिक संरचना CH3-CH2-CH=CH2 है।
   • इसका ओजोनी अपघटन ब्यूटेन-1,2-डायोन और फॉर्मल्डिहाइड देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

3. प्रोपीन (Option 3):

   • प्रोपीन का रासायनिक संरचना CH3-CH=CH2 है।
   • इसका ओजोनी अपघटन प्रोपेनल और फॉर्मल्डिहाइड देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

4. ब्यूट-2-ईन (Option 4):

   • ब्यूट-2-ईन का रासायनिक संरचना CH3-CH=CH-CH3 है।
   • इसका ओजोनी अपघटन एथेन-1,2-डायोन देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

इस प्रकार, 2-मेथिल प्रोपीन ही वह एल्कीन है जिसका ओजोनी अपघटन प्रोपेन-2-ओन और मेथनैल देता है। यही कारण है कि Option 1 सही उत्तर है।

The compound given is CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH. To determine the correct IUPAC name, we need to analyze the structure and functional groups present in the compound.

1. Explanation for Option 2: 5-oxohexanoic acid

   • The compound has a total of six carbon atoms in the longest continuous chain, which corresponds to "hexanoic acid."
   • The presence of a carboxylic acid group (-COOH) at the end of the chain confirms the "hexanoic acid" part of the name.
   • There is a ketone group (C=O) located on the fifth carbon of the chain, which is indicated by "5-oxo."
   • Therefore, the correct IUPAC name for the compound is "5-oxohexanoic acid," which matches Option 2.

2. Explanation for why other options are incorrect:

   • Option 1: 6-carboxy hexan-2-one

     • This option suggests a carboxylic acid group at the sixth position and a ketone at the second position. However, the compound has a carboxylic acid group at the end of the chain, not at the sixth position, and the ketone is at the fifth position, not the second. Therefore, this option does not accurately describe the structure of the compound.

   • Option 3: Butyl methyl ketone

     • This name implies a ketone with a butyl group and a methyl group attached to the carbonyl carbon. The compound in question has a carboxylic acid group and a ketone, not a simple ketone with butyl and methyl groups. Thus, this option does not fit the structure of the compound.

   • Option 4: 1,5-diketohexanol

     • This option suggests two ketone groups and an alcohol group. The compound has one ketone group and two carboxylic acid groups, not an alcohol group. Therefore, this option is incorrect for the given compound.

In conclusion, Option 2, "5-oxohexanoic acid," is the correct IUPAC name for the compound, as it accurately describes the structure with a ketone group at the fifth position and a carboxylic acid group at the end of the six-carbon chain.

निम्नलिखित यौगिक का IUPAC नाम है: CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH

सही उत्तर: विकल्प 2. 5-ऑक्सो हेक्सेनोइक अम्ल

विस्तृत व्याख्या:

1. विकल्प 2: 5-ऑक्सो हेक्सेनोइक अम्ल
   यह विकल्प सही है क्योंकि यौगिक में एक कार्बोक्सिलिक अम्ल समूह (-COOH) और एक कीटोन समूह (=O) उपस्थित हैं। यौगिक की संरचना में कुल 6 कार्बन परमाणु हैं, जो इसे हेक्सेन श्रृंखला का बनाते हैं। कीटोन समूह पांचवें कार्बन पर स्थित है, इसलिए इसे 5-ऑक्सो कहा जाता है। इस प्रकार, यौगिक का IUPAC नाम 5-ऑक्सो हेक्सेनोइक अम्ल है।

2. विकल्प 1: 6-कार्बोक्सी हेक्सेन-2-ओन
   यह विकल्प गलत है क्योंकि यौगिक में कार्बोक्सी समूह (COOH) अंत में है, न कि छठे स्थान पर। इसके अलावा, कीटोन समूह दूसरे स्थान पर नहीं है, बल्कि पांचवें स्थान पर है।

3. विकल्प 3: ब्यूटिल मेथिल कीटोन
   यह विकल्प गलत है क्योंकि ब्यूटिल मेथिल कीटोन में केवल तीन कार्बन परमाणु होते हैं, जबकि दिए गए यौगिक में छह कार्बन परमाणु हैं। इसके अलावा, इसमें कार्बोक्सिलिक अम्ल समूह भी है, जो इस विकल्प में नहीं है।

4. विकल्प 4: 1,5-डाईकीटो हेक्सेनॉल
   यह विकल्प गलत है क्योंकि यौगिक में दो कीटोन समूह नहीं हैं, बल्कि एक कीटोन और एक कार्बोक्सिलिक अम्ल समूह है। इसके अलावा, यौगिक में कोई अल्कोहल समूह (OH) नहीं है, जो इस विकल्प में दर्शाया गया है।

इस प्रकार, विकल्प 2 सही है क्योंकि यह यौगिक की संरचना और कार्यात्मक समूहों को सही ढंग से दर्शाता है।

Option 3 is the correct choice for the denaturation of ethyl alcohol because it includes methanol, pyridine, and copper sulphate, which are commonly used denaturants. Here's why each component in Option 3 is suitable for this purpose:

1. Methanol: Methanol is a common denaturant for ethyl alcohol. It is toxic and makes the alcohol unfit for consumption. Its addition ensures that the ethyl alcohol cannot be used for drinking purposes, which is the primary goal of denaturation.

2. Pyridine: Pyridine is another effective denaturant. It has a strong, unpleasant odor and taste, which further discourages consumption. Its chemical properties make it an excellent choice for altering the sensory characteristics of ethyl alcohol.

3. Copper Sulphate: Copper sulphate is used to impart a distinct color to the alcohol, making it visually identifiable as denatured. This visual cue is important for preventing accidental ingestion.

Now, let's examine why the other options are incorrect:

1. Option 1 (Methanol, Water, Copper Chloride): While methanol is a suitable denaturant, water and copper chloride are not typically used for denaturing alcohol. Water dilutes the alcohol but does not render it undrinkable, and copper chloride does not have the necessary properties to effectively denature alcohol.

2. Option 2 (Propanol, Vinegar, Potassium Permanganate): Propanol is not commonly used as a denaturant for ethyl alcohol. Vinegar, being acetic acid, does not effectively denature alcohol, and potassium permanganate is not suitable for this purpose due to its oxidizing properties, which could lead to unwanted chemical reactions.

3. Option 4 (Vinegar, Pyridine, Water): While pyridine is a suitable denaturant, vinegar and water are not effective for denaturing alcohol. Vinegar does not have the necessary toxic or sensory-altering properties, and water merely dilutes the alcohol without denaturing it.

In conclusion, Option 3 is the correct choice because it includes methanol, pyridine, and copper sulphate, all of which are effective denaturants that alter the chemical, sensory, and visual properties of ethyl alcohol, making it unfit for consumption.

एथिल ऐल्कोहॉल के विकृतिकरण के लिए सही विकल्प विकल्प 3 है: मेथेनॉल, पिरिडीन, कॉपर सल्फेट। आइए इसे विस्तार से समझते हैं:

1. विकल्प 3: मेथेनॉल, पिरिडीन, कॉपर सल्फेट
   एथिल ऐल्कोहॉल के विकृतिकरण के लिए मेथेनॉल और पिरिडीन का उपयोग एक सामान्य प्रक्रिया है। पिरिडीन एक कार्बनिक यौगिक है जो विकृतिकरण प्रक्रिया में सहायक होता है। कॉपर सल्फेट एक ऑक्सीडाइजिंग एजेंट के रूप में कार्य करता है, जो एथिल ऐल्कोहॉल को ऑक्सीडाइज करके इसे विकृत करता है। इस प्रक्रिया में, कॉपर सल्फेट एथिल ऐल्कोहॉल के साथ प्रतिक्रिया करता है और इसे अन्य यौगिकों में परिवर्तित करता है। इसलिए, यह विकल्प सही है।

2. विकल्प 1: मेथेनॉल, जल, कॉपर क्लोराइड
   इस विकल्प में जल और कॉपर क्लोराइड का उपयोग किया गया है। हालांकि कॉपर क्लोराइड एक ऑक्सीडाइजिंग एजेंट हो सकता है, लेकिन जल का उपयोग विकृतिकरण प्रक्रिया में सहायक नहीं होता है। इसलिए, यह विकल्प सही नहीं है।

3. विकल्प 2: प्रोपेनॉल, सिरका, पोटैशियम परमैंगनेट
   इस विकल्प में प्रोपेनॉल और सिरका का उपयोग किया गया है, जो एथिल ऐल्कोहॉल के विकृतिकरण के लिए उपयुक्त नहीं हैं। पोटैशियम परमैंगनेट एक ऑक्सीडाइजिंग एजेंट है, लेकिन प्रोपेनॉल और सिरका का उपयोग इस संदर्भ में सही नहीं है। इसलिए, यह विकल्प सही नहीं है।

4. विकल्प 4: सिरका, पिरिडीन, जल
   इस विकल्प में सिरका और जल का उपयोग किया गया है। सिरका और जल एथिल ऐल्कोहॉल के विकृतिकरण में सहायक नहीं होते हैं। पिरिडीन का उपयोग सही है, लेकिन सिरका और जल के कारण यह विकल्प सही नहीं है।

इस प्रकार, विकल्प 3 सही है क्योंकि इसमें मेथेनॉल, पिरिडीन, और कॉपर सल्फेट का संयोजन एथिल ऐल्कोहॉल के विकृतिकरण के लिए उपयुक्त है।

Soaps are formed by the reaction of esters with caustic soda, a process known as saponification. Let's delve into why Option 4 is correct and why the other options are not suitable for soap formation.

1. Explanation for Option 4 (Esters):

   • Esters are organic compounds that react with caustic soda (sodium hydroxide, NaOH) in a process called saponification. During this reaction, the ester is hydrolyzed to produce glycerol and soap, which is the sodium salt of a fatty acid. This is the fundamental chemical reaction used in soap making. The general reaction can be represented as:
     [
     \text{Ester} + \text{Caustic Soda (NaOH)} \rightarrow \text{Soap} + \text{Glycerol}
     ]
   • This process is widely used in the industrial production of soap, confirming that esters are indeed the correct reactants for soap formation.

2. Why Option 1 (Carbonyl Compounds) is Incorrect:

   • Carbonyl compounds include aldehydes and ketones, which do not undergo saponification with caustic soda. These compounds do not have the ester linkage necessary for the formation of soap. While they can participate in other types of reactions, they are not involved in the soap-making process.

3. Why Option 2 (Alcohols) is Incorrect:

   • Alcohols, such as methanol or ethanol, do not react with caustic soda to form soap. Alcohols lack the ester functional group required for saponification. Although alcohols can be used as solvents or reactants in other chemical processes, they do not directly participate in the formation of soap.

4. Why Option 3 (Phenols) is Incorrect:

   • Phenols are aromatic compounds that contain a hydroxyl group directly bonded to an aromatic ring. They do not react with caustic soda to produce soap. Phenols have different chemical properties and reactivity compared to esters and are not involved in the saponification process.

In conclusion, the correct answer is Option 4 (Esters) because esters are the specific compounds that react with caustic soda to form soap through the saponification process. The other options do not have the necessary chemical structure to participate in this reaction.

साबुन बनाने की प्रक्रिया को साबुनीकरण (Saponification) कहा जाता है। यह प्रक्रिया तब होती है जब एस्टरों की अभिक्रिया कास्टिक सोडा (सोडियम हाइड्रॉक्साइड) के साथ की जाती है। एस्टर, जो कि वसा या तेल होते हैं, कास्टिक सोडा के साथ प्रतिक्रिया करके ग्लिसरॉल और साबुन (फैटी एसिड के सोडियम लवण) का निर्माण करते हैं। इस प्रक्रिया में एस्टर का हाइड्रोलिसिस होता है, जिससे साबुन का निर्माण होता है। इसलिए, विकल्प 4 सही है।

अब अन्य विकल्पों की चर्चा करते हैं:

1. कार्बोनिल यौगिकों: कार्बोनिल यौगिकों में कार्बन-ऑक्सीजन डबल बॉन्ड होता है, जैसे कि एल्डिहाइड और कीटोन। ये यौगिक साबुन बनाने की प्रक्रिया में सीधे शामिल नहीं होते हैं।

2. ऐल्कोहलों: ऐल्कोहल, जैसे कि इथेनॉल, साबुन बनाने की प्रक्रिया में सीधे तौर पर शामिल नहीं होते हैं। हालांकि, वे कुछ प्रक्रियाओं में सहायक के रूप में उपयोग हो सकते हैं, लेकिन वे साबुन के निर्माण के लिए आवश्यक नहीं हैं।

3. फीनॉलों: फीनॉल एक प्रकार का ऐल्कोहल है जिसमें हाइड्रॉक्सिल समूह सीधे एरोमैटिक रिंग से जुड़ा होता है। फीनॉल का उपयोग साबुन बनाने में नहीं किया जाता है।

इस प्रकार, एस्टरों की कास्टिक सोडा के साथ अभिक्रिया ही साबुन बनाने की सही प्रक्रिया है, इसलिए विकल्प 4 सही है।

The correct answer is Option 3: "Carbon chain end of the soap interacts with the oil."

Explanation Supporting Option 3:

Soap molecules are amphiphilic, meaning they have two distinct ends with different affinities. One end is hydrophilic (water-attracting) and ionic, while the other end is hydrophobic (water-repelling) and consists of a long carbon chain. The carbon chain end of the soap molecule is non-polar, making it compatible with non-polar substances like oil. When soap is added to a mixture of oil and water, the hydrophobic carbon chain end of the soap molecule embeds itself into the oil droplets. This interaction is driven by the principle of "like dissolves like," where non-polar substances interact favorably with other non-polar substances.

Explanation for Why Other Options are Incorrect:

1. Option 1: Ionic end of the soap interacts with the oil.

   • The ionic end of the soap molecule is hydrophilic and is attracted to water, not oil. It does not interact with oil because oil is non-polar, and the ionic end is polar. Polar and non-polar substances do not mix well, so the ionic end cannot effectively interact with oil.

2. Option 2: The closest end of the soap (either ionic or carbon chain) interacts with oil.

   • The interaction between soap and oil is not determined by proximity but by chemical compatibility. The carbon chain end is specifically designed to interact with non-polar substances like oil, regardless of which end is closer. Therefore, this option is incorrect because it oversimplifies the interaction based on proximity rather than chemical properties.

3. Option 4: Neither ionic end nor carbon chain interacts with oil since soap is made up from oil.

   • This statement is incorrect because it misunderstands the nature of soap. While soap is derived from fats and oils, its amphiphilic structure allows it to interact with both water and oil. The carbon chain end specifically interacts with oil, allowing soap to emulsify and remove oil from surfaces. Therefore, this option is incorrect as it denies the fundamental property of soap that enables it to interact with oil.

In conclusion, Option 3 is the correct answer because the carbon chain end of the soap molecule is specifically designed to interact with oil, allowing soap to effectively emulsify and clean oily substances.

साबुन अणु के दो सिरे होते हैं: एक आयनिक सिरा और दूसरा कार्बन श्रृंखला वाला सिरा। जब साबुन का उपयोग तेल या ग्रीस को हटाने के लिए किया जाता है, तो साबुन का कार्बन श्रृंखला वाला सिरा तेल के साथ अन्योन्य क्रिया करता है। यह प्रक्रिया इस प्रकार होती है:

1. कार्बन श्रृंखला वाला सिरा: साबुन का यह सिरा हाइड्रोफोबिक (जल-विरोधी) होता है और यह तेल या ग्रीस के साथ अन्योन्य क्रिया करता है। चूंकि तेल और कार्बन श्रृंखला दोनों ही गैर-ध्रुवीय होते हैं, इसलिए वे एक-दूसरे के साथ घुल-मिल जाते हैं। यह अन्योन्य क्रिया तेल के अणुओं को घेर लेती है और उन्हें पानी में घुलने योग्य बना देती है।

2. आयनिक सिरा: साबुन का आयनिक सिरा हाइड्रोफिलिक (जल-प्रेमी) होता है और यह पानी के साथ अन्योन्य क्रिया करता है। यह सिरा पानी में घुल जाता है और साबुन के अणु को पानी में स्थिर रखता है।

अब, आइए अन्य विकल्पों को समझें और देखें कि वे क्यों गलत हैं:

1. विकल्प 1: "साबुन का आयनिक सिरा तेल से अन्योन्य क्रिया करता है।" यह गलत है क्योंकि आयनिक सिरा पानी के साथ अन्योन्य क्रिया करता है, न कि तेल के साथ।

2. विकल्प 2: "साबुन का निकटतम सिरा (आयनिक अथवा कार्बन श्रृंखला) तेल से अन्योन्य क्रिया करता है।" यह विकल्प अस्पष्ट है और सही नहीं है क्योंकि केवल कार्बन श्रृंखला वाला सिरा ही तेल के साथ अन्योन्य क्रिया करता है।

3. विकल्प 4: "चूंकि साबुन तेल से बना होता है अतः तेल से उसका न तो आयनिक सिरा और न ही कार्बन श्रृंखला सिरा अन्योन्य क्रिया करता है।" यह गलत है क्योंकि साबुन का कार्बन श्रृंखला वाला सिरा तेल के साथ अन्योन्य क्रिया करता है।

इस प्रकार, सही उत्तर विकल्प 3 है: "साबुन का कार्बन श्रृंखला वाला सिरा तेल से अन्योन्य क्रिया करता है।"

The correct answer is Option 3: $SO\overline{_3} Na^+$.

1. Explanation for Option 3 ($SO\overline{_3} Na^+$):

   • Synthetic detergents are composed of molecules that have both hydrophilic (water-attracting) and hydrophobic (water-repelling) parts. The hydrophilic end is typically a polar or ionic group that can interact with water molecules.
   • The $SO\overline{_3} Na^+$ group is a sulfonate group, which is highly polar and ionic. This makes it very effective at interacting with water molecules, thus making it hydrophilic. The presence of the sodium ion ($Na^+$) further enhances its solubility in water, as it can dissociate and interact with water molecules.
   • Sulfonate groups are commonly used in synthetic detergents because they provide excellent solubility and cleaning properties, making them ideal for the hydrophilic end of detergent molecules.

2. Explanation for why other options are incorrect:

   • Option 1 ($CH_3-(CH_2)_{10}-CH_2-$):

     • This is a hydrocarbon chain, which is non-polar and hydrophobic. Hydrocarbon chains do not interact well with water and are typically the hydrophobic part of a detergent molecule, not the hydrophilic part.

   • Option 2 ($CO\overline{_3} Na^+$):

     • This represents a carbonate group. While carbonate ions can interact with water, they are not typically used as the hydrophilic end in synthetic detergents. The sulfonate group ($SO\overline{_3} Na^+$) is more effective and commonly used for this purpose due to its superior solubility and cleaning properties.

   • Option 4 ($COO^- Na^+$):

     • This is a carboxylate group, which can be hydrophilic. However, in the context of synthetic detergents, sulfonate groups are preferred for their enhanced solubility and stability in various pH conditions. Carboxylate groups are more commonly found in soaps rather than synthetic detergents.

In conclusion, Option 3 ($SO\overline{_3} Na^+$) is the correct answer because it represents a sulfonate group, which is highly effective as the hydrophilic end of a synthetic detergent due to its ionic nature and excellent solubility in water.

एक संश्लेषित अपमार्जक का जलस्नेही सिरा वह हिस्सा होता है जो पानी के साथ घुलनशील होता है। संश्लेषित अपमार्जक में एक जलस्नेही (हाइड्रोफिलिक) सिरा और एक जलविकर्षी (हाइड्रोफोबिक) पूंछ होती है।

विकल्प 3: $SO\overline{_3} Na^+$

यह सल्फोनेट समूह है, जो एक जलस्नेही समूह है। सल्फोनेट समूह पानी में घुलनशील होते हैं और इसीलिए यह अपमार्जक के जलस्नेही सिरे के रूप में कार्य करता है। सल्फोनेट समूह में सल्फर और ऑक्सीजन के बीच का बंधन इसे पानी के साथ घुलनशील बनाता है, जिससे यह पानी के साथ आसानी से इंटरैक्ट कर सकता है।

अन्य विकल्पों का विश्लेषण:

1. विकल्प 1: $CH_3-(CH_2)_{10}-CH_2-$

यह एक लंबी हाइड्रोकार्बन श्रृंखला है, जो जलविकर्षी होती है। यह पानी में घुलनशील नहीं होती और इसलिए यह अपमार्जक का जलस्नेही सिरा नहीं हो सकता।

2. विकल्प 2: $CO\overline{_3} Na^+$

यह कार्बोनेट आयन है, जो आमतौर पर पानी में घुलनशील होता है, लेकिन यह अपमार्जक के जलस्नेही सिरे के रूप में नहीं जाना जाता। यह विकल्प अपमार्जक के संदर्भ में सही नहीं है।

4. विकल्प 4: $COO^- Na^+$

यह कार्बोक्सिलेट आयन है, जो कुछ हद तक जलस्नेही हो सकता है, लेकिन यह सल्फोनेट समूह जितना प्रभावी नहीं है। सल्फोनेट समूह अधिक सामान्य और प्रभावी जलस्नेही सिरा होता है।

इस प्रकार, विकल्प 3 ($SO\overline{_3} Na^+$) सही उत्तर है क्योंकि यह अपमार्जक के जलस्नेही सिरे के रूप में सबसे उपयुक्त है।