HTET Exam - Level 1 PRT - Chemistry

To determine why Option 1, 2-Methyl Propene, is the correct answer for the ozonolysis reaction that yields propan-2-one and methanal, let's analyze the process of ozonolysis and the structure of the given alkenes.

Explanation for Option 1: 2-Methyl Propene

1. Structure of 2-Methyl Propene:

   • 2-Methyl Propene is an alkene with the structure CH3-C(CH3)=CH2. It has a double bond between the second and third carbon atoms.

2. Ozonolysis Reaction:

   • Ozonolysis involves the cleavage of the carbon-carbon double bond by ozone (O3), followed by reductive workup, typically with zinc and water, to yield carbonyl compounds.
   • For 2-Methyl Propene, the double bond between the second and third carbon atoms is cleaved. This results in the formation of two fragments:
     • One fragment is acetone (propan-2-one), CH3-CO-CH3, derived from the carbon atoms 1 and 2.
     • The other fragment is formaldehyde (methanal), H-CHO, derived from the carbon atom 3.

3. Conclusion:

   • The ozonolysis of 2-Methyl Propene perfectly matches the products given in the question: propan-2-one and methanal. Therefore, Option 1 is the correct answer.

Explanation for Why Other Options are Incorrect

1. Option 2: But-1-ene:

   • Structure: CH2=CH-CH2-CH3
   • Ozonolysis of But-1-ene would yield two molecules of ethanal (acetaldehyde), CH3-CHO, not propan-2-one and methanal.

2. Option 3: Propene:

   • Structure: CH2=CH-CH3
   • Ozonolysis of Propene would yield one molecule of ethanal (CH3-CHO) and one molecule of formaldehyde (H-CHO), not propan-2-one.

3. Option 4: But-2-ene:

   • Structure: CH3-CH=CH-CH3
   • Ozonolysis of But-2-ene would yield two molecules of acetone (propan-2-one), not methanal.

In summary, the ozonolysis of 2-Methyl Propene is the only reaction that produces the specified products, propan-2-one and methanal, confirming that Option 1 is indeed the correct answer.

2-मेथिल प्रोपीन का ओजोनी अपघटन प्रोपेन-2-ओन और मेथनैल देता है। आइए इसे विस्तार से समझते हैं:

1. 2-मेथिल प्रोपीन (Option 1):

   • 2-मेथिल प्रोपीन का रासायनिक संरचना CH3-C(CH3)=CH2 है।
   • जब इसका ओजोनी अपघटन होता है, तो यह दो भागों में टूटता है: एक भाग प्रोपेन-2-ओन (CH3-CO-CH3) बनाता है और दूसरा भाग मेथनैल (HCHO) बनाता है।
   • यह प्रतिक्रिया ओजोनोलिसिस की प्रक्रिया के अनुसार होती है, जहां डबल बॉन्ड के दोनों कार्बन परमाणु ऑक्सीजन के साथ जुड़कर कार्बोनिल यौगिक बनाते हैं।

2. ब्यूट-1-ईन (Option 2):

   • ब्यूट-1-ईन का रासायनिक संरचना CH3-CH2-CH=CH2 है।
   • इसका ओजोनी अपघटन ब्यूटेन-1,2-डायोन और फॉर्मल्डिहाइड देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

3. प्रोपीन (Option 3):

   • प्रोपीन का रासायनिक संरचना CH3-CH=CH2 है।
   • इसका ओजोनी अपघटन प्रोपेनल और फॉर्मल्डिहाइड देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

4. ब्यूट-2-ईन (Option 4):

   • ब्यूट-2-ईन का रासायनिक संरचना CH3-CH=CH-CH3 है।
   • इसका ओजोनी अपघटन एथेन-1,2-डायोन देता है, जो प्रोपेन-2-ओन और मेथनैल नहीं है।

इस प्रकार, 2-मेथिल प्रोपीन ही वह एल्कीन है जिसका ओजोनी अपघटन प्रोपेन-2-ओन और मेथनैल देता है। यही कारण है कि Option 1 सही उत्तर है।

The compound given is CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH. To determine the correct IUPAC name, we need to analyze the structure and functional groups present in the compound.

1. Explanation for Option 2: 5-oxohexanoic acid

   • The compound has a total of six carbon atoms in the longest continuous chain, which corresponds to "hexanoic acid."
   • The presence of a carboxylic acid group (-COOH) at the end of the chain confirms the "hexanoic acid" part of the name.
   • There is a ketone group (C=O) located on the fifth carbon of the chain, which is indicated by "5-oxo."
   • Therefore, the correct IUPAC name for the compound is "5-oxohexanoic acid," which matches Option 2.

2. Explanation for why other options are incorrect:

   • Option 1: 6-carboxy hexan-2-one

     • This option suggests a carboxylic acid group at the sixth position and a ketone at the second position. However, the compound has a carboxylic acid group at the end of the chain, not at the sixth position, and the ketone is at the fifth position, not the second. Therefore, this option does not accurately describe the structure of the compound.

   • Option 3: Butyl methyl ketone

     • This name implies a ketone with a butyl group and a methyl group attached to the carbonyl carbon. The compound in question has a carboxylic acid group and a ketone, not a simple ketone with butyl and methyl groups. Thus, this option does not fit the structure of the compound.

   • Option 4: 1,5-diketohexanol

     • This option suggests two ketone groups and an alcohol group. The compound has one ketone group and two carboxylic acid groups, not an alcohol group. Therefore, this option is incorrect for the given compound.

In conclusion, Option 2, "5-oxohexanoic acid," is the correct IUPAC name for the compound, as it accurately describes the structure with a ketone group at the fifth position and a carboxylic acid group at the end of the six-carbon chain.

निम्नलिखित यौगिक का IUPAC नाम है: CH3-C(=OH)-CH2-CH2-CH2-C(=OH)-OH

सही उत्तर: विकल्प 2. 5-ऑक्सो हेक्सेनोइक अम्ल

विस्तृत व्याख्या:

1. विकल्प 2: 5-ऑक्सो हेक्सेनोइक अम्ल
   यह विकल्प सही है क्योंकि यौगिक में एक कार्बोक्सिलिक अम्ल समूह (-COOH) और एक कीटोन समूह (=O) उपस्थित हैं। यौगिक की संरचना में कुल 6 कार्बन परमाणु हैं, जो इसे हेक्सेन श्रृंखला का बनाते हैं। कीटोन समूह पांचवें कार्बन पर स्थित है, इसलिए इसे 5-ऑक्सो कहा जाता है। इस प्रकार, यौगिक का IUPAC नाम 5-ऑक्सो हेक्सेनोइक अम्ल है।

2. विकल्प 1: 6-कार्बोक्सी हेक्सेन-2-ओन
   यह विकल्प गलत है क्योंकि यौगिक में कार्बोक्सी समूह (COOH) अंत में है, न कि छठे स्थान पर। इसके अलावा, कीटोन समूह दूसरे स्थान पर नहीं है, बल्कि पांचवें स्थान पर है।

3. विकल्प 3: ब्यूटिल मेथिल कीटोन
   यह विकल्प गलत है क्योंकि ब्यूटिल मेथिल कीटोन में केवल तीन कार्बन परमाणु होते हैं, जबकि दिए गए यौगिक में छह कार्बन परमाणु हैं। इसके अलावा, इसमें कार्बोक्सिलिक अम्ल समूह भी है, जो इस विकल्प में नहीं है।

4. विकल्प 4: 1,5-डाईकीटो हेक्सेनॉल
   यह विकल्प गलत है क्योंकि यौगिक में दो कीटोन समूह नहीं हैं, बल्कि एक कीटोन और एक कार्बोक्सिलिक अम्ल समूह है। इसके अलावा, यौगिक में कोई अल्कोहल समूह (OH) नहीं है, जो इस विकल्प में दर्शाया गया है।

इस प्रकार, विकल्प 2 सही है क्योंकि यह यौगिक की संरचना और कार्यात्मक समूहों को सही ढंग से दर्शाता है।

Option 3 is the correct choice for the denaturation of ethyl alcohol because it includes methanol, pyridine, and copper sulphate, which are commonly used denaturants. Here's why each component in Option 3 is suitable for this purpose:

1. Methanol: Methanol is a common denaturant for ethyl alcohol. It is toxic and makes the alcohol unfit for consumption. Its addition ensures that the ethyl alcohol cannot be used for drinking purposes, which is the primary goal of denaturation.

2. Pyridine: Pyridine is another effective denaturant. It has a strong, unpleasant odor and taste, which further discourages consumption. Its chemical properties make it an excellent choice for altering the sensory characteristics of ethyl alcohol.

3. Copper Sulphate: Copper sulphate is used to impart a distinct color to the alcohol, making it visually identifiable as denatured. This visual cue is important for preventing accidental ingestion.

Now, let's examine why the other options are incorrect:

1. Option 1 (Methanol, Water, Copper Chloride): While methanol is a suitable denaturant, water and copper chloride are not typically used for denaturing alcohol. Water dilutes the alcohol but does not render it undrinkable, and copper chloride does not have the necessary properties to effectively denature alcohol.

2. Option 2 (Propanol, Vinegar, Potassium Permanganate): Propanol is not commonly used as a denaturant for ethyl alcohol. Vinegar, being acetic acid, does not effectively denature alcohol, and potassium permanganate is not suitable for this purpose due to its oxidizing properties, which could lead to unwanted chemical reactions.

3. Option 4 (Vinegar, Pyridine, Water): While pyridine is a suitable denaturant, vinegar and water are not effective for denaturing alcohol. Vinegar does not have the necessary toxic or sensory-altering properties, and water merely dilutes the alcohol without denaturing it.

In conclusion, Option 3 is the correct choice because it includes methanol, pyridine, and copper sulphate, all of which are effective denaturants that alter the chemical, sensory, and visual properties of ethyl alcohol, making it unfit for consumption.

एथिल ऐल्कोहॉल के विकृतिकरण के लिए सही विकल्प विकल्प 3 है: मेथेनॉल, पिरिडीन, कॉपर सल्फेट। आइए इसे विस्तार से समझते हैं:

1. विकल्प 3: मेथेनॉल, पिरिडीन, कॉपर सल्फेट
   एथिल ऐल्कोहॉल के विकृतिकरण के लिए मेथेनॉल और पिरिडीन का उपयोग एक सामान्य प्रक्रिया है। पिरिडीन एक कार्बनिक यौगिक है जो विकृतिकरण प्रक्रिया में सहायक होता है। कॉपर सल्फेट एक ऑक्सीडाइजिंग एजेंट के रूप में कार्य करता है, जो एथिल ऐल्कोहॉल को ऑक्सीडाइज करके इसे विकृत करता है। इस प्रक्रिया में, कॉपर सल्फेट एथिल ऐल्कोहॉल के साथ प्रतिक्रिया करता है और इसे अन्य यौगिकों में परिवर्तित करता है। इसलिए, यह विकल्प सही है।

2. विकल्प 1: मेथेनॉल, जल, कॉपर क्लोराइड
   इस विकल्प में जल और कॉपर क्लोराइड का उपयोग किया गया है। हालांकि कॉपर क्लोराइड एक ऑक्सीडाइजिंग एजेंट हो सकता है, लेकिन जल का उपयोग विकृतिकरण प्रक्रिया में सहायक नहीं होता है। इसलिए, यह विकल्प सही नहीं है।

3. विकल्प 2: प्रोपेनॉल, सिरका, पोटैशियम परमैंगनेट
   इस विकल्प में प्रोपेनॉल और सिरका का उपयोग किया गया है, जो एथिल ऐल्कोहॉल के विकृतिकरण के लिए उपयुक्त नहीं हैं। पोटैशियम परमैंगनेट एक ऑक्सीडाइजिंग एजेंट है, लेकिन प्रोपेनॉल और सिरका का उपयोग इस संदर्भ में सही नहीं है। इसलिए, यह विकल्प सही नहीं है।

4. विकल्प 4: सिरका, पिरिडीन, जल
   इस विकल्प में सिरका और जल का उपयोग किया गया है। सिरका और जल एथिल ऐल्कोहॉल के विकृतिकरण में सहायक नहीं होते हैं। पिरिडीन का उपयोग सही है, लेकिन सिरका और जल के कारण यह विकल्प सही नहीं है।

इस प्रकार, विकल्प 3 सही है क्योंकि इसमें मेथेनॉल, पिरिडीन, और कॉपर सल्फेट का संयोजन एथिल ऐल्कोहॉल के विकृतिकरण के लिए उपयुक्त है।

Soaps are formed by the reaction of esters with caustic soda, a process known as saponification. Let's delve into why Option 4 is correct and why the other options are not suitable for soap formation.

1. Explanation for Option 4 (Esters):

   • Esters are organic compounds that react with caustic soda (sodium hydroxide, NaOH) in a process called saponification. During this reaction, the ester is hydrolyzed to produce glycerol and soap, which is the sodium salt of a fatty acid. This is the fundamental chemical reaction used in soap making. The general reaction can be represented as:
     [
     \text{Ester} + \text{Caustic Soda (NaOH)} \rightarrow \text{Soap} + \text{Glycerol}
     ]
   • This process is widely used in the industrial production of soap, confirming that esters are indeed the correct reactants for soap formation.

2. Why Option 1 (Carbonyl Compounds) is Incorrect:

   • Carbonyl compounds include aldehydes and ketones, which do not undergo saponification with caustic soda. These compounds do not have the ester linkage necessary for the formation of soap. While they can participate in other types of reactions, they are not involved in the soap-making process.

3. Why Option 2 (Alcohols) is Incorrect:

   • Alcohols, such as methanol or ethanol, do not react with caustic soda to form soap. Alcohols lack the ester functional group required for saponification. Although alcohols can be used as solvents or reactants in other chemical processes, they do not directly participate in the formation of soap.

4. Why Option 3 (Phenols) is Incorrect:

   • Phenols are aromatic compounds that contain a hydroxyl group directly bonded to an aromatic ring. They do not react with caustic soda to produce soap. Phenols have different chemical properties and reactivity compared to esters and are not involved in the saponification process.

In conclusion, the correct answer is Option 4 (Esters) because esters are the specific compounds that react with caustic soda to form soap through the saponification process. The other options do not have the necessary chemical structure to participate in this reaction.

साबुन बनाने की प्रक्रिया को साबुनीकरण (Saponification) कहा जाता है। यह प्रक्रिया तब होती है जब एस्टरों की अभिक्रिया कास्टिक सोडा (सोडियम हाइड्रॉक्साइड) के साथ की जाती है। एस्टर, जो कि वसा या तेल होते हैं, कास्टिक सोडा के साथ प्रतिक्रिया करके ग्लिसरॉल और साबुन (फैटी एसिड के सोडियम लवण) का निर्माण करते हैं। इस प्रक्रिया में एस्टर का हाइड्रोलिसिस होता है, जिससे साबुन का निर्माण होता है। इसलिए, विकल्प 4 सही है।

अब अन्य विकल्पों की चर्चा करते हैं:

1. कार्बोनिल यौगिकों: कार्बोनिल यौगिकों में कार्बन-ऑक्सीजन डबल बॉन्ड होता है, जैसे कि एल्डिहाइड और कीटोन। ये यौगिक साबुन बनाने की प्रक्रिया में सीधे शामिल नहीं होते हैं।

2. ऐल्कोहलों: ऐल्कोहल, जैसे कि इथेनॉल, साबुन बनाने की प्रक्रिया में सीधे तौर पर शामिल नहीं होते हैं। हालांकि, वे कुछ प्रक्रियाओं में सहायक के रूप में उपयोग हो सकते हैं, लेकिन वे साबुन के निर्माण के लिए आवश्यक नहीं हैं।

3. फीनॉलों: फीनॉल एक प्रकार का ऐल्कोहल है जिसमें हाइड्रॉक्सिल समूह सीधे एरोमैटिक रिंग से जुड़ा होता है। फीनॉल का उपयोग साबुन बनाने में नहीं किया जाता है।

इस प्रकार, एस्टरों की कास्टिक सोडा के साथ अभिक्रिया ही साबुन बनाने की सही प्रक्रिया है, इसलिए विकल्प 4 सही है।

The correct answer is Option 3: "Carbon chain end of the soap interacts with the oil."

Explanation Supporting Option 3:

Soap molecules are amphiphilic, meaning they have two distinct ends with different affinities. One end is hydrophilic (water-attracting) and ionic, while the other end is hydrophobic (water-repelling) and consists of a long carbon chain. The carbon chain end of the soap molecule is non-polar, making it compatible with non-polar substances like oil. When soap is added to a mixture of oil and water, the hydrophobic carbon chain end of the soap molecule embeds itself into the oil droplets. This interaction is driven by the principle of "like dissolves like," where non-polar substances interact favorably with other non-polar substances.

Explanation for Why Other Options are Incorrect:

1. Option 1: Ionic end of the soap interacts with the oil.

   • The ionic end of the soap molecule is hydrophilic and is attracted to water, not oil. It does not interact with oil because oil is non-polar, and the ionic end is polar. Polar and non-polar substances do not mix well, so the ionic end cannot effectively interact with oil.

2. Option 2: The closest end of the soap (either ionic or carbon chain) interacts with oil.

   • The interaction between soap and oil is not determined by proximity but by chemical compatibility. The carbon chain end is specifically designed to interact with non-polar substances like oil, regardless of which end is closer. Therefore, this option is incorrect because it oversimplifies the interaction based on proximity rather than chemical properties.

3. Option 4: Neither ionic end nor carbon chain interacts with oil since soap is made up from oil.

   • This statement is incorrect because it misunderstands the nature of soap. While soap is derived from fats and oils, its amphiphilic structure allows it to interact with both water and oil. The carbon chain end specifically interacts with oil, allowing soap to emulsify and remove oil from surfaces. Therefore, this option is incorrect as it denies the fundamental property of soap that enables it to interact with oil.

In conclusion, Option 3 is the correct answer because the carbon chain end of the soap molecule is specifically designed to interact with oil, allowing soap to effectively emulsify and clean oily substances.

साबुन अणु के दो सिरे होते हैं: एक आयनिक सिरा और दूसरा कार्बन श्रृंखला वाला सिरा। जब साबुन का उपयोग तेल या ग्रीस को हटाने के लिए किया जाता है, तो साबुन का कार्बन श्रृंखला वाला सिरा तेल के साथ अन्योन्य क्रिया करता है। यह प्रक्रिया इस प्रकार होती है:

1. कार्बन श्रृंखला वाला सिरा: साबुन का यह सिरा हाइड्रोफोबिक (जल-विरोधी) होता है और यह तेल या ग्रीस के साथ अन्योन्य क्रिया करता है। चूंकि तेल और कार्बन श्रृंखला दोनों ही गैर-ध्रुवीय होते हैं, इसलिए वे एक-दूसरे के साथ घुल-मिल जाते हैं। यह अन्योन्य क्रिया तेल के अणुओं को घेर लेती है और उन्हें पानी में घुलने योग्य बना देती है।

2. आयनिक सिरा: साबुन का आयनिक सिरा हाइड्रोफिलिक (जल-प्रेमी) होता है और यह पानी के साथ अन्योन्य क्रिया करता है। यह सिरा पानी में घुल जाता है और साबुन के अणु को पानी में स्थिर रखता है।

अब, आइए अन्य विकल्पों को समझें और देखें कि वे क्यों गलत हैं:

1. विकल्प 1: "साबुन का आयनिक सिरा तेल से अन्योन्य क्रिया करता है।" यह गलत है क्योंकि आयनिक सिरा पानी के साथ अन्योन्य क्रिया करता है, न कि तेल के साथ।

2. विकल्प 2: "साबुन का निकटतम सिरा (आयनिक अथवा कार्बन श्रृंखला) तेल से अन्योन्य क्रिया करता है।" यह विकल्प अस्पष्ट है और सही नहीं है क्योंकि केवल कार्बन श्रृंखला वाला सिरा ही तेल के साथ अन्योन्य क्रिया करता है।

3. विकल्प 4: "चूंकि साबुन तेल से बना होता है अतः तेल से उसका न तो आयनिक सिरा और न ही कार्बन श्रृंखला सिरा अन्योन्य क्रिया करता है।" यह गलत है क्योंकि साबुन का कार्बन श्रृंखला वाला सिरा तेल के साथ अन्योन्य क्रिया करता है।

इस प्रकार, सही उत्तर विकल्प 3 है: "साबुन का कार्बन श्रृंखला वाला सिरा तेल से अन्योन्य क्रिया करता है।"

The correct answer is Option 3: $SO\overline{_3} Na^+$.

1. Explanation for Option 3 ($SO\overline{_3} Na^+$):

   • Synthetic detergents are composed of molecules that have both hydrophilic (water-attracting) and hydrophobic (water-repelling) parts. The hydrophilic end is typically a polar or ionic group that can interact with water molecules.
   • The $SO\overline{_3} Na^+$ group is a sulfonate group, which is highly polar and ionic. This makes it very effective at interacting with water molecules, thus making it hydrophilic. The presence of the sodium ion ($Na^+$) further enhances its solubility in water, as it can dissociate and interact with water molecules.
   • Sulfonate groups are commonly used in synthetic detergents because they provide excellent solubility and cleaning properties, making them ideal for the hydrophilic end of detergent molecules.

2. Explanation for why other options are incorrect:

   • Option 1 ($CH_3-(CH_2)_{10}-CH_2-$):

     • This is a hydrocarbon chain, which is non-polar and hydrophobic. Hydrocarbon chains do not interact well with water and are typically the hydrophobic part of a detergent molecule, not the hydrophilic part.

   • Option 2 ($CO\overline{_3} Na^+$):

     • This represents a carbonate group. While carbonate ions can interact with water, they are not typically used as the hydrophilic end in synthetic detergents. The sulfonate group ($SO\overline{_3} Na^+$) is more effective and commonly used for this purpose due to its superior solubility and cleaning properties.

   • Option 4 ($COO^- Na^+$):

     • This is a carboxylate group, which can be hydrophilic. However, in the context of synthetic detergents, sulfonate groups are preferred for their enhanced solubility and stability in various pH conditions. Carboxylate groups are more commonly found in soaps rather than synthetic detergents.

In conclusion, Option 3 ($SO\overline{_3} Na^+$) is the correct answer because it represents a sulfonate group, which is highly effective as the hydrophilic end of a synthetic detergent due to its ionic nature and excellent solubility in water.

एक संश्लेषित अपमार्जक का जलस्नेही सिरा वह हिस्सा होता है जो पानी के साथ घुलनशील होता है। संश्लेषित अपमार्जक में एक जलस्नेही (हाइड्रोफिलिक) सिरा और एक जलविकर्षी (हाइड्रोफोबिक) पूंछ होती है।

विकल्प 3: $SO\overline{_3} Na^+$

यह सल्फोनेट समूह है, जो एक जलस्नेही समूह है। सल्फोनेट समूह पानी में घुलनशील होते हैं और इसीलिए यह अपमार्जक के जलस्नेही सिरे के रूप में कार्य करता है। सल्फोनेट समूह में सल्फर और ऑक्सीजन के बीच का बंधन इसे पानी के साथ घुलनशील बनाता है, जिससे यह पानी के साथ आसानी से इंटरैक्ट कर सकता है।

अन्य विकल्पों का विश्लेषण:

1. विकल्प 1: $CH_3-(CH_2)_{10}-CH_2-$

यह एक लंबी हाइड्रोकार्बन श्रृंखला है, जो जलविकर्षी होती है। यह पानी में घुलनशील नहीं होती और इसलिए यह अपमार्जक का जलस्नेही सिरा नहीं हो सकता।

2. विकल्प 2: $CO\overline{_3} Na^+$

यह कार्बोनेट आयन है, जो आमतौर पर पानी में घुलनशील होता है, लेकिन यह अपमार्जक के जलस्नेही सिरे के रूप में नहीं जाना जाता। यह विकल्प अपमार्जक के संदर्भ में सही नहीं है।

4. विकल्प 4: $COO^- Na^+$

यह कार्बोक्सिलेट आयन है, जो कुछ हद तक जलस्नेही हो सकता है, लेकिन यह सल्फोनेट समूह जितना प्रभावी नहीं है। सल्फोनेट समूह अधिक सामान्य और प्रभावी जलस्नेही सिरा होता है।

इस प्रकार, विकल्प 3 ($SO\overline{_3} Na^+$) सही उत्तर है क्योंकि यह अपमार्जक के जलस्नेही सिरे के रूप में सबसे उपयुक्त है।

Option 2, Nylon 6, is the correct answer because it exhibits the highest intermolecular force of attraction among the given polymers. This is primarily due to the presence of hydrogen bonding in its structure. Nylon 6 is a type of polyamide, and its polymer chains contain amide groups (-CONH-) that can form strong hydrogen bonds with each other. These hydrogen bonds significantly enhance the intermolecular forces, leading to higher tensile strength, melting point, and overall durability compared to other polymers listed.

Now, let's examine why the other options are incorrect:

1. PVC (Polyvinyl Chloride): PVC is a polymer made from the polymerization of vinyl chloride monomers. The primary intermolecular forces in PVC are van der Waals forces, which are weaker than hydrogen bonds. PVC does not have functional groups capable of forming hydrogen bonds, resulting in lower intermolecular forces compared to Nylon 6.

2. Buna S (Styrene-Butadiene Rubber): Buna S is a synthetic rubber composed of styrene and butadiene. The intermolecular forces in Buna S are primarily van der Waals forces, similar to PVC. The absence of polar functional groups means it cannot form hydrogen bonds, making its intermolecular forces weaker than those in Nylon 6.

3. Neoprene (Polychloroprene): Neoprene is a type of synthetic rubber made from chloroprene. Like PVC and Buna S, Neoprene's intermolecular forces are mainly van der Waals forces. Although it has some degree of polarity due to the presence of chlorine atoms, it still lacks the ability to form hydrogen bonds, resulting in weaker intermolecular forces compared to Nylon 6.

In conclusion, Nylon 6 stands out among the options due to its ability to form strong hydrogen bonds, which significantly enhance its intermolecular forces, making it the correct answer.

नाइलॉन-6 में उच्चतम अंतरआण्विक बल पाया जाता है, और इसे सही विकल्प के रूप में चुना गया है। आइए इसे विस्तार से समझें:

1. नाइलॉन-6: नाइलॉन-6 एक प्रकार का पॉलीअमाइड है, जिसमें हाइड्रोजन बॉन्डिंग के कारण उच्च अंतरआण्विक बल होते हैं। हाइड्रोजन बॉन्डिंग एक मजबूत अंतरआण्विक बल है जो नाइलॉन-6 के मॉलिक्यूल्स को एक साथ मजबूती से बांधता है। यह इसे उच्च तन्यता शक्ति और स्थायित्व प्रदान करता है, जो इसे अन्य बहुलकों की तुलना में अधिक मजबूत बनाता है।

2. PVC (पॉलीविनाइल क्लोराइड): PVC में मुख्य रूप से वान डर वाल्स बल होते हैं, जो हाइड्रोजन बॉन्डिंग की तुलना में कमजोर होते हैं। इसलिए, PVC में अंतरआण्विक बल नाइलॉन-6 की तुलना में कम होते हैं।

3. ब्यूना-S: ब्यूना-S एक प्रकार का सिंथेटिक रबर है, जिसमें मुख्य रूप से वान डर वाल्स बल होते हैं। यह बल नाइलॉन-6 में पाए जाने वाले हाइड्रोजन बॉन्डिंग की तुलना में कमजोर होते हैं, जिससे ब्यूना-S में अंतरआण्विक बल कम होते हैं।

4. निओप्रीन: निओप्रीन भी एक प्रकार का सिंथेटिक रबर है, जिसमें वान डर वाल्स बल होते हैं। यह बल नाइलॉन-6 के हाइड्रोजन बॉन्डिंग की तुलना में कमजोर होते हैं, जिससे निओप्रीन में अंतरआण्विक बल कम होते हैं।

इस प्रकार, नाइलॉन-6 में उच्चतम अंतरआण्विक बल होते हैं, जो इसे अन्य विकल्पों की तुलना में अधिक मजबूत और टिकाऊ बनाते हैं। यही कारण है कि विकल्प 2 सही उत्तर है।

The major contributor to global warming is carbon dioxide ($CO_{2}$), which is identified as Option 3. Here is a detailed explanation supporting why $CO_{2}$ is the correct answer, along with reasons why the other options are incorrect:

1. Why $CO_{2}$ is the Correct Answer:

   • Abundance and Persistence: Carbon dioxide is the most abundant greenhouse gas emitted by human activities, primarily from the burning of fossil fuels such as coal, oil, and natural gas. It accounts for the largest share of greenhouse gases in the atmosphere.
   • Long Atmospheric Lifetime: $CO_{2}$ has a long atmospheric lifetime, meaning it remains in the atmosphere for a long time, contributing to the greenhouse effect and global warming over extended periods.
   • Significant Impact on Climate: The increase in $CO_{2}$ levels is closely linked to the rise in global temperatures. It traps heat in the Earth's atmosphere, leading to the warming of the planet, which is a primary driver of climate change.

2. Why the Other Options are Incorrect:

   • CFCs (Option 1): Chlorofluorocarbons (CFCs) are potent greenhouse gases and have a high global warming potential. However, their concentration in the atmosphere is much lower compared to $CO_{2}$. Additionally, international agreements like the Montreal Protocol have significantly reduced their emissions.
   • $N_{2}O$ (Option 2): Nitrous oxide is another greenhouse gas with a high global warming potential, but it is present in much smaller quantities than $CO_{2}$. Its sources include agricultural activities and industrial processes, but its overall contribution to global warming is less than that of $CO_{2}$.
   • $CH_{4}$ (Option 4): Methane is a potent greenhouse gas with a higher warming potential than $CO_{2}$ on a per molecule basis. However, it is present in much lower concentrations in the atmosphere. While it is a significant contributor to global warming, its overall impact is still less than that of $CO_{2}$ due to its lower abundance.

In conclusion, while other greenhouse gases like CFCs, $N_{2}O$, and $CH_{4}$ contribute to global warming, $CO_{2}$ is the major contributor due to its high concentration, long atmospheric lifetime, and significant impact on the Earth's climate.

भूमण्डलीय तापवृद्धि के लिए $CO_{2}$ का विशिष्ट योगदान है। इसका कारण यह है कि $CO_{2}$ वातावरण में सबसे अधिक मात्रा में पाया जाने वाला ग्रीनहाउस गैस है और इसका उत्सर्जन मुख्य रूप से जीवाश्म ईंधनों के जलने, औद्योगिक प्रक्रियाओं और वनों की कटाई से होता है। $CO_{2}$ वातावरण में लंबे समय तक बना रहता है और यह पृथ्वी की सतह से विकिरणित ऊष्मा को अवशोषित करके उसे वापस पृथ्वी की ओर विकिरित करता है, जिससे तापमान में वृद्धि होती है। इस प्रक्रिया को ग्रीनहाउस प्रभाव कहा जाता है, जो वैश्विक तापवृद्धि का मुख्य कारण है।

अन्य विकल्पों की बात करें तो:

1. CFCs (क्लोरोफ्लोरोकार्बन): ये ग्रीनहाउस गैसें हैं और ओजोन परत के क्षय के लिए जिम्मेदार हैं, लेकिन इनका वैश्विक तापवृद्धि में योगदान $CO_{2}$ की तुलना में कम है। CFCs का उपयोग मुख्य रूप से रेफ्रिजरेंट्स और एरोसोल स्प्रे में होता था, लेकिन इनके उपयोग पर अब काफी हद तक प्रतिबंध लगा दिया गया है।

2. $N_{2}O$ (नाइट्रस ऑक्साइड): यह भी एक ग्रीनहाउस गैस है और इसका योगदान कृषि गतिविधियों, जैसे कि उर्वरकों के उपयोग से होता है। हालांकि, इसका वैश्विक तापवृद्धि में योगदान $CO_{2}$ की तुलना में कम है।

3. $CH_{4}$ (मीथेन): यह भी एक प्रभावी ग्रीनहाउस गैस है और इसका उत्सर्जन कृषि, पशुपालन और जीवाश्म ईंधनों के उत्पादन से होता है। हालांकि, मीथेन का वातावरण में जीवनकाल कम होता है और इसका कुल योगदान $CO_{2}$ की तुलना में कम है।

इस प्रकार, $CO_{2}$ का वैश्विक तापवृद्धि में सबसे अधिक योगदान है, इसलिए विकल्प 3 सही है।

Photochemical smog is a type of air pollution that is primarily formed when sunlight reacts with pollutants such as nitrogen oxides (NOx) and volatile organic compounds (VOCs) in the atmosphere. The components of photochemical smog are typically secondary pollutants that result from these reactions.

1. Explanation for Option 4 (CFC's):

   • Chlorofluorocarbons (CFCs) are compounds that were commonly used as refrigerants, propellants in aerosol applications, and solvents. They are known for their role in ozone layer depletion rather than being a component of photochemical smog. CFCs do not participate in the chemical reactions that lead to the formation of photochemical smog. Therefore, they are not considered a common component of photochemical smog, making Option 4 the correct answer.

2. Explanation for why the other options are incorrect:

   • Option 1 ($O_{3}$): Ozone ($O_{3}$) is a major component of photochemical smog. It is formed when nitrogen oxides (NOx) and volatile organic compounds (VOCs) react in the presence of sunlight. Ozone at ground level is a harmful pollutant and a key indicator of photochemical smog.
   • Option 2 (Peroxyacetyl nitrate): Peroxyacetyl nitrate (PAN) is another component of photochemical smog. It is a secondary pollutant formed from the reaction of VOCs and NOx in the presence of sunlight. PAN is known for its eye-irritating properties and its role in photochemical smog.
   • Option 3 (Nitric oxide): Nitric oxide (NO) is a primary pollutant that plays a crucial role in the formation of photochemical smog. It is emitted from vehicles and industrial processes and reacts with oxygen in the atmosphere to form nitrogen dioxide (NO2), which is involved in the formation of ozone and other components of smog.

In conclusion, while $O_{3}$, peroxyacetyl nitrate, and nitric oxide are all directly involved in the formation and composition of photochemical smog, CFCs are not. Therefore, Option 4 is correctly identified as not being a common component of photochemical smog.

प्रकाश रासायनिक धूम्र कोहरा (photochemical smog) एक जटिल वायुमंडलीय घटना है जो मुख्य रूप से सूर्य के प्रकाश की उपस्थिति में नाइट्रोजन ऑक्साइड्स (NOx) और वाष्पशील कार्बनिक यौगिकों (VOCs) के बीच रासायनिक प्रतिक्रियाओं के परिणामस्वरूप उत्पन्न होती है। आइए अब प्रत्येक विकल्प का विश्लेषण करें:

1. $O_{3}$ (ओजोन): ओजोन प्रकाश रासायनिक धूम्र कोहरे का एक प्रमुख घटक है। यह सूर्य के प्रकाश की उपस्थिति में नाइट्रोजन ऑक्साइड्स और वाष्पशील कार्बनिक यौगिकों के बीच प्रतिक्रियाओं के माध्यम से बनता है। इसलिए, यह प्रकाश रासायनिक धूम्र कोहरे का सामान्य घटक है।

2. परॉक्सीऐसीटिल नाइट्रेट (PAN): परॉक्सीऐसीटिल नाइट्रेट भी प्रकाश रासायनिक धूम्र कोहरे का एक सामान्य घटक है। यह नाइट्रोजन ऑक्साइड्स और वाष्पशील कार्बनिक यौगिकों के बीच प्रतिक्रियाओं के माध्यम से बनता है और धूम्र कोहरे में एक महत्वपूर्ण भूमिका निभाता है।

3. नाइट्रिक ऑक्साइड (NO): नाइट्रिक ऑक्साइड प्रकाश रासायनिक धूम्र कोहरे के निर्माण में एक प्रारंभिक घटक है। यह सूर्य के प्रकाश की उपस्थिति में ओजोन और अन्य ऑक्सीडेंट्स के निर्माण में योगदान देता है। इसलिए, यह भी धूम्र कोहरे का सामान्य घटक है।

4. CFC's (क्लोरोफ्लोरोकार्बन): CFC's प्रकाश रासायनिक धूम्र कोहरे का सामान्य घटक नहीं हैं। CFC's मुख्य रूप से ओजोन परत के क्षय के लिए जिम्मेदार होते हैं और इनका प्रकाश रासायनिक धूम्र कोहरे के निर्माण में कोई सीधा योगदान नहीं होता है। इसलिए, यह विकल्प सही उत्तर है।

इस प्रकार, विकल्प 4 (CFC's) सही उत्तर है क्योंकि यह प्रकाश रासायनिक धूम्र कोहरे का सामान्य घटक नहीं है।

Option 1, "Cotton and Rayon," is the correct answer because both cotton and rayon are derived from cellulose, which is a natural polymer found in the cell walls of plants.

1. Cotton: Cotton is a natural fiber that is directly obtained from the cotton plant. The primary component of cotton is cellulose, which makes up about 90% of the fiber. Cellulose is a carbohydrate polymer that provides structure to plant cells, and in the case of cotton, it is spun into threads to make fabric.

2. Rayon: Rayon is a semi-synthetic fiber made from regenerated cellulose. The process of making rayon involves dissolving cellulose from wood pulp or cotton linters and then regenerating it into fibers. Although it undergoes chemical processing, the base material for rayon is still cellulose, making it a cellulose-derived fabric.

Now, let's explain why the other options are incorrect:

• Option 2: Rayon and Nylon: While rayon is derived from cellulose, nylon is a completely synthetic fiber made from petrochemicals. Nylon is a polyamide, not related to cellulose, and is produced through a chemical process involving the polymerization of monomers like adipic acid and hexamethylenediamine.

• Option 3: Nylon and Silk: As mentioned, nylon is a synthetic fiber not derived from cellulose. Silk, on the other hand, is a natural protein fiber produced by silkworms. It is composed of proteins like fibroin and sericin, not cellulose. Therefore, neither nylon nor silk is obtained from cellulose.

• Option 4: Silk and Cotton: While cotton is indeed a cellulose-based fiber, silk is not. Silk is a protein-based fiber, as explained earlier. Therefore, this option is incorrect because only one of the two fibers listed (cotton) is derived from cellulose.

In conclusion, Option 1 is the correct answer because both cotton and rayon are obtained from cellulose, whereas the other options include fibers that are either synthetic or protein-based and not derived from cellulose.

सेलूलोज़ से प्राप्त कपड़े हैं: सूती एवं रेयॉन।

1. विस्तृत व्याख्या क्यों विकल्प 1 सही है:

   • सूती (Cotton): सूती कपड़ा प्राकृतिक रूप से सेलूलोज़ से प्राप्त होता है। कपास के पौधे के रेशों से सूती कपड़ा बनाया जाता है, और ये रेशे मुख्य रूप से सेलूलोज़ से बने होते हैं। इसलिए, सूती कपड़ा सीधे तौर पर सेलूलोज़ से प्राप्त होता है।
   • रेयॉन (Rayon): रेयॉन एक अर्ध-सिंथेटिक फाइबर है जो प्राकृतिक सेलूलोज़ से बनाया जाता है। इसे लकड़ी के गूदे या अन्य सेलूलोज़ स्रोतों से प्राप्त किया जाता है और फिर रासायनिक प्रक्रियाओं के माध्यम से इसे रेयॉन फाइबर में परिवर्तित किया जाता है। इस प्रकार, रेयॉन भी सेलूलोज़ से प्राप्त होता है।

2. अन्य विकल्प क्यों गलत हैं:

   • विकल्प 2 (रेयॉन एवं नायलॉन): जबकि रेयॉन सेलूलोज़ से प्राप्त होता है, नायलॉन एक पूरी तरह से सिंथेटिक फाइबर है जो पेट्रोलियम उत्पादों से बनाया जाता है, न कि सेलूलोज़ से। इसलिए, यह विकल्प गलत है।
   • विकल्प 3 (नायलॉन एवं रेशम): नायलॉन, जैसा कि पहले बताया गया है, सेलूलोज़ से प्राप्त नहीं होता है। रेशम एक प्राकृतिक प्रोटीन फाइबर है जो रेशम के कीड़ों के कोकून से प्राप्त होता है, न कि सेलूलोज़ से। इसलिए, यह विकल्प भी गलत है।
   • विकल्प 4 (रेशम एवं सूती): जबकि सूती कपड़ा सेलूलोज़ से प्राप्त होता है, रेशम नहीं होता है। रेशम प्रोटीन आधारित होता है और इसे रेशम के कीड़ों से प्राप्त किया जाता है। इसलिए, यह विकल्प भी गलत है।

इस प्रकार, विकल्प 1 (सूती एवं रेयॉन) सही उत्तर है क्योंकि ये दोनों कपड़े सेलूलोज़ से प्राप्त होते हैं।

To justify why Option 4 is the correct answer, let's examine the relationship between the monomers in List-I and their corresponding polymers in List-II:

1. Chloroethene and P.V.C.:

   • Chloroethene, also known as vinyl chloride, is the monomer used to produce polyvinyl chloride (P.V.C.). P.V.C. is a widely used plastic known for its durability and resistance to environmental degradation. Therefore, the correct match for chloroethene is P.V.C., which corresponds to (a)(iv).

2. Caprolactam and Nylon-6:

   • Caprolactam is the monomer used in the production of Nylon-6, a type of synthetic polymer known for its strength and elasticity. Nylon-6 is commonly used in textiles and engineering plastics. Thus, the correct match for caprolactam is Nylon-6, which corresponds to (b)(iii).

3. Isoprene and Natural Rubber:

   • Isoprene is the monomer that polymerizes to form natural rubber. Natural rubber is an elastomer that is harvested from rubber trees and is used in a variety of applications, including tires and footwear. Therefore, the correct match for isoprene is natural rubber, which corresponds to (c)(ii).

4. Acrylonitrile and P.A.N.:

   • Acrylonitrile is the monomer used to produce polyacrylonitrile (P.A.N.), which is a polymer used in the production of acrylic fibers and as a precursor for carbon fiber. Thus, the correct match for acrylonitrile is P.A.N., which corresponds to (d)(i).

Now, let's explain why the other options are incorrect:

• Option 1: This option incorrectly matches chloroethene with P.A.N., caprolactam with natural rubber, isoprene with Nylon-6, and acrylonitrile with P.V.C. None of these matches are correct based on the chemical properties and uses of the monomers and polymers.

• Option 2: This option incorrectly matches chloroethene with P.V.C. (which is correct), but then incorrectly matches caprolactam with natural rubber, isoprene with P.A.N., and acrylonitrile with Nylon-6. These mismatches do not align with the known polymerization processes.

• Option 3: This option correctly matches chloroethene with P.V.C., but incorrectly matches caprolactam with P.A.N., isoprene with natural rubber (which is correct), and acrylonitrile with Nylon-6. The incorrect matches for caprolactam and acrylonitrile make this option incorrect.

In conclusion, Option 4 is the only option that correctly matches each monomer with its corresponding polymer, based on the chemical properties and industrial applications of these substances.

सूची-I और सूची-II के बीच सही सुमेलित करने के लिए हमें एकलकों और उनके संबंधित बहुलकों के बीच संबंध को समझना होगा। आइए प्रत्येक विकल्प का विश्लेषण करें और देखें कि क्यों विकल्प 4 सही है:

1. क्लोरोएथीन : पी० वी० सी० (Polyvinyl Chloride)
   क्लोरोएथीन, जिसे विनाइल क्लोराइड भी कहा जाता है, का उपयोग पी० वी० सी० (Polyvinyl Chloride) बनाने के लिए किया जाता है। यह एक सामान्य बहुलक है जिसका उपयोग पाइप, केबल इन्सुलेशन, और अन्य उत्पादों में किया जाता है।

2. कैप्रोलैक्टम : नाइलॉन-6
   कैप्रोलैक्टम एकलकों का उपयोग नाइलॉन-6 बनाने के लिए किया जाता है। नाइलॉन-6 एक महत्वपूर्ण सिंथेटिक फाइबर है जिसका उपयोग वस्त्र, कालीन, और औद्योगिक धागों में किया जाता है।

3. आइसोप्रीन : प्राकृतिक रबड़
   आइसोप्रीन एकलकों का उपयोग प्राकृतिक रबड़ के निर्माण में होता है। प्राकृतिक रबड़ का उपयोग टायर, जूते, और अन्य लचीले उत्पादों में किया जाता है।

4. एक्रिलोनाइट्राइल : पी० ए० एन० (Polyacrylonitrile)
   एक्रिलोनाइट्राइल का उपयोग पी० ए० एन० (Polyacrylonitrile) बनाने के लिए किया जाता है, जो एक प्रकार का सिंथेटिक फाइबर है जिसका उपयोग वस्त्र और अन्य अनुप्रयोगों में होता है।

अब, आइए देखें कि अन्य विकल्प क्यों गलत हैं:

• विकल्प 1: इसमें क्लोरोएथीन को पी० ए० एन० के साथ जोड़ा गया है, जो गलत है। क्लोरोएथीन पी० वी० सी० बनाता है।
• विकल्प 2: इसमें कैप्रोलैक्टम को प्राकृतिक रबड़ के साथ जोड़ा गया है, जो गलत है। कैप्रोलैक्टम नाइलॉन-6 बनाता है।
• विकल्प 3: इसमें आइसोप्रीन को पी० ए० एन० के साथ जोड़ा गया है, जो गलत है। आइसोप्रीन प्राकृतिक रबड़ बनाता है।

इस प्रकार, विकल्प 4 सही है क्योंकि यह सभी एकलकों और उनके संबंधित बहुलकों को सही ढंग से सुमेलित करता है।

Option 2 is the correct answer, which states that statements (a), (c), and (d) are correct. Let's provide a detailed explanation for each statement and why Option 2 is the correct choice.

1. Statement (a): PMMA is used in making eye lenses.

   • PMMA stands for Polymethyl methacrylate, which is a transparent thermoplastic often used as a lightweight or shatter-resistant alternative to glass. It is indeed used in making various optical devices, including eye lenses, due to its excellent clarity and optical properties. Therefore, statement (a) is correct.

2. Statement (c): Nylon is the step growth polymer.

   • Nylon is a type of synthetic polymer known as a polyamide. It is produced through a step-growth polymerization process, which involves the reaction of monomers with two functional groups. This process is characteristic of step-growth polymers, distinguishing them from chain-growth polymers. Therefore, statement (c) is correct.

3. Statement (d): Vulcanisation was introduced by Charles Goodyear.

   • Vulcanization is a chemical process for converting rubber into more durable materials by adding sulfur or other equivalent curatives or accelerators. This process was indeed introduced by Charles Goodyear in 1839, which significantly improved the properties of natural rubber. Therefore, statement (d) is correct.

Now, let's explain why the other options are incorrect:

• Option 1: (a), (b) तथा (c) सही हैं

  • Statement (b) is incorrect. Nylon-66 is not manufactured by caprolactam; it is made from hexamethylenediamine and adipic acid. Caprolactam is used in the production of Nylon-6, not Nylon-66. Therefore, Option 1 is incorrect.

• Option 3: (b), (c) तथा (d) सही हैं

  • As explained above, statement (b) is incorrect because Nylon-66 is not manufactured by caprolactam. Therefore, Option 3 is incorrect.

• Option 4: (a), (b) तथा (d) सही हैं

  • Again, statement (b) is incorrect for the same reason mentioned earlier. Therefore, Option 4 is incorrect.

In conclusion, Option 2 is the correct answer because it accurately identifies the correct statements: (a), (c), and (d).

Option 2, which states that statements (a), (c), and (d) are correct, is indeed the correct answer. Let's delve into each statement to understand why this option is correct and why the others are not.

1. Statement (a): PMMA आँख के लेन्स बनाने में प्रयुक्त होता है।

   • PMMA, or Polymethyl methacrylate, is a transparent thermoplastic often used as a lightweight or shatter-resistant alternative to glass. It is commonly used in the production of lenses, including those for the eyes, due to its excellent optical clarity and stability. Therefore, statement (a) is correct.

2. Statement (c): नाइलॉन पद वृद्धि बहुलक है।

   • Nylon is indeed a step-growth polymer. Step-growth polymerization involves the reaction of bifunctional or multifunctional monomers, forming a polymer through a stepwise reaction. Nylon is typically produced through the step-growth polymerization of diamines and dicarboxylic acids or their derivatives. Thus, statement (c) is correct.

3. Statement (d): वल्कनीकरण प्रक्रिया चार्ल्स गुडइयर ने दी।

   • Vulcanization is a chemical process for converting rubber into more durable materials by adding sulfur or other accelerators. Charles Goodyear is credited with the invention of the vulcanization process in 1839. Therefore, statement (d) is correct.

Now, let's address why the other options are incorrect:

• Option 1: (a), (b), and (c) are correct

  • Statement (b) is incorrect. Nylon-66 is not made from caprolactam; it is made from hexamethylenediamine and adipic acid. Caprolactam is used to produce Nylon-6, not Nylon-66. Therefore, this option is incorrect.

• Option 3: (b), (c), and (d) are correct

  • As explained above, statement (b) is incorrect because caprolactam is used to produce Nylon-6, not Nylon-66. Thus, this option is incorrect.

• Option 4: (a), (b), and (d) are correct

  • Again, statement (b) is incorrect for the same reason mentioned earlier. Therefore, this option is incorrect.

In conclusion, Option 2 is the correct answer because it accurately identifies the correct statements: (a), (c), and (d).

Neoprene is a synthetic rubber that is prepared through the polymerization of 2-chloro-1,3-butadiene, which is also known as chloroprene. This process involves the linking of multiple chloroprene molecules to form a large polymer chain, resulting in neoprene. Neoprene is known for its excellent chemical stability and flexibility over a wide temperature range, making it suitable for various applications such as wetsuits, hoses, and gaskets.

1. Explanation for Option 1 (2-chloro-1,3-butadiene):

   • Neoprene is specifically synthesized from the monomer 2-chloro-1,3-butadiene. The presence of the chlorine atom in the monomer is crucial as it imparts unique properties to the resulting polymer, such as resistance to oil, chemicals, and heat. The polymerization of chloroprene involves free radical mechanisms, leading to the formation of neoprene, which is a type of polychloroprene.

2. Explanation for why other options are incorrect:

   • Option 2 (2-methyl-1,3-butadiene):

     • 2-methyl-1,3-butadiene, also known as isoprene, is the monomer used to produce natural rubber, not neoprene. The polymerization of isoprene results in polyisoprene, which has different properties compared to neoprene. Therefore, this option is incorrect for the synthesis of neoprene.

   • Option 3 (1,3-butadiene):

     • 1,3-butadiene is used in the production of synthetic rubbers such as polybutadiene and styrene-butadiene rubber (SBR), but it is not used to produce neoprene. The absence of a chlorine atom in 1,3-butadiene means it cannot form the chlorinated polymer structure characteristic of neoprene.

   • Option 4 (Acrylonitrile):

     • Acrylonitrile is a monomer used in the production of polymers like polyacrylonitrile and acrylonitrile butadiene styrene (ABS), but it is not involved in the synthesis of neoprene. Acrylonitrile lacks the necessary structure to form neoprene, which requires the chlorinated structure provided by 2-chloro-1,3-butadiene.

In conclusion, the correct answer is Option 1, as neoprene is specifically synthesized from 2-chloro-1,3-butadiene, and the other options do not provide the necessary chemical structure for the production of neoprene.

नियोप्रिन एक सिंथेटिक रबर है जिसे 2-क्लोरो-1,3-ब्यूटाडाईन के बहुलकीकरण से बनाया जाता है। यह प्रक्रिया नियोप्रिन को विशेष गुण प्रदान करती है, जैसे कि तेल, गर्मी, और रासायनिक पदार्थों के प्रति उच्च प्रतिरोध। अब हम देखेंगे कि अन्य विकल्प क्यों गलत हैं:

1. 2-क्लोरो-1,3-ब्यूटाडाईन (सही उत्तर): यह यौगिक नियोप्रिन के निर्माण के लिए आवश्यक है। इसके बहुलकीकरण से नियोप्रिन बनता है, जो अपनी उच्च स्थायित्व और लचीलेपन के लिए जाना जाता है।

2. 2-मेथिल-1,3-ब्यूटाडाईन: इसे आइसोप्रीन भी कहा जाता है और यह प्राकृतिक रबर के निर्माण में उपयोग होता है, न कि नियोप्रिन के। इसलिए, यह विकल्प गलत है।

3. 1,3-ब्यूटाडाईन: यह यौगिक सिंथेटिक रबर जैसे कि स्टायरीन-ब्यूटाडाईन रबर (SBR) के निर्माण में उपयोग होता है, लेकिन नियोप्रिन के लिए नहीं। इसलिए, यह विकल्प भी गलत है।

4. एक्राईलोनाइट्रिल: यह यौगिक नाइट्राइल रबर (NBR) के निर्माण में उपयोग होता है, जो तेल और पेट्रोलियम उत्पादों के प्रति प्रतिरोधी होता है, लेकिन नियोप्रिन के निर्माण में इसका उपयोग नहीं होता। इसलिए, यह विकल्प गलत है।

इस प्रकार, 2-क्लोरो-1,3-ब्यूटाडाईन का बहुलकीकरण ही नियोप्रिन के निर्माण के लिए सही प्रक्रिया है, और यही कारण है कि विकल्प 1 सही उत्तर है।

Option 1, "Domestic Science," is the correct answer for what Home Science was initially referred to as. Here's a detailed explanation supporting this choice:

1. Explanation for Option 1 (Domestic Science):

   • Home Science, as a field of study, originated in the late 19th and early 20th centuries. During this time, it was primarily focused on the management of the household and the application of scientific principles to domestic tasks. The term "Domestic Science" was used to describe this discipline because it emphasized the scientific approach to managing home-related activities, such as cooking, cleaning, and budgeting. The aim was to improve the efficiency and effectiveness of household management, which was a significant concern during that era. As the field evolved, it expanded to include a broader range of topics and eventually became known as Home Science.

2. Explanation for why other options are incorrect:

   • Option 2 (Home Science): While "Home Science" is the modern term used for this field, it was not the original name. The discipline evolved into what we now call Home Science, but initially, it was referred to as Domestic Science.

   • Option 3 (Environmental Science): Environmental Science is a distinct field that focuses on the study of the environment and solutions to environmental problems. It is unrelated to the domestic and household focus of Home Science. Therefore, it was never used as an initial term for Home Science.

   • Option 4 (Life Science): Life Science is a broad term that encompasses various biological sciences, including biology, botany, and zoology. It does not specifically relate to the domestic and household management focus of Home Science. Hence, it was not the original term used for Home Science.

In conclusion, "Domestic Science" accurately reflects the initial focus and terminology of what we now know as Home Science, making Option 1 the correct answer.

प्रारंभिक दौर में, गृह विज्ञान को "घरेलू विज्ञान" कहा जाता था। इसका कारण यह है कि गृह विज्ञान का मूल उद्देश्य घर के अंदर के कार्यों और प्रबंधन को वैज्ञानिक दृष्टिकोण से समझना और सुधारना था। यह विषय मुख्य रूप से घर के प्रबंधन, भोजन, कपड़े, और परिवार के स्वास्थ्य से संबंधित था। इसलिए, इसे "घरेलू विज्ञान" कहा जाता था क्योंकि यह घर के अंदर के कार्यों और गतिविधियों पर केंद्रित था।

अब आइए अन्य विकल्पों पर चर्चा करते हैं और समझते हैं कि वे क्यों गलत हैं:

2. गृह विज्ञान: यह वर्तमान में इस विषय का नाम है, लेकिन प्रारंभिक दौर में इसे "घरेलू विज्ञान" कहा जाता था। इसलिए यह विकल्प सही नहीं है।

3. पर्यावरण विज्ञान: यह एक अलग विषय है जो पर्यावरण और पारिस्थितिकी से संबंधित है। इसका गृह विज्ञान से कोई सीधा संबंध नहीं है, इसलिए यह विकल्प गलत है।

4. जीवन विज्ञान: यह जीव विज्ञान का एक व्यापक क्षेत्र है जो जीवों के जीवन और उनके कार्यों का अध्ययन करता है। यह गृह विज्ञान के उद्देश्यों और विषयों से मेल नहीं खाता, इसलिए यह विकल्प भी गलत है।

इस प्रकार, "घरेलू विज्ञान" (विकल्प 1) सही उत्तर है क्योंकि यह प्रारंभिक दौर में गृह विज्ञान के लिए प्रयुक्त नाम था।

The middle zone of a candle flame is referred to as the zone of partial combustion. This is because the combustion process in this zone is not complete, leading to the presence of unburnt carbon particles. These particles are responsible for the yellowish glow of the flame, as they become incandescent due to the heat. The incomplete combustion occurs because there is not enough oxygen available in this zone to allow for complete combustion of the fuel.

1. Explanation for Option 4 (Partial):

   • In the middle zone of a candle flame, the combustion is partial due to insufficient oxygen supply. This results in the production of soot and a yellow flame. The carbon particles in this zone do not fully oxidize, which is characteristic of partial combustion. This is why Option 4, "Partial," is the correct answer.

2. Explanation for why other options are incorrect:

   • Option 1 (Spontaneous): Spontaneous combustion refers to a process where a material ignites without an external flame or spark, typically due to internal heat buildup. This is not applicable to the middle zone of a candle flame, where combustion is initiated by an external source (the wick) and is not spontaneous.
   • Option 2 (Rapid): Rapid combustion is a type of combustion that occurs quickly and releases a large amount of heat and light, such as in explosions. While the candle flame does produce light and heat, the term "rapid" does not accurately describe the nature of combustion in the middle zone, which is characterized by incomplete burning.
   • Option 3 (Complete): Complete combustion occurs when there is sufficient oxygen to allow the fuel to burn fully, producing carbon dioxide and water as byproducts. The middle zone of a candle flame does not have enough oxygen for complete combustion, which is why it is not the correct description for this zone.

In summary, the middle zone of a candle flame is best described as the zone of partial combustion due to the incomplete burning of fuel and the presence of unburnt carbon particles.

मोमबत्ती की ज्वाला के मध्य का भाग "आंशिक दहन का भाग" कहलाता है। इसका कारण यह है कि ज्वाला के इस भाग में ऑक्सीजन की कमी होती है, जिसके कारण दहन प्रक्रिया पूरी तरह से नहीं हो पाती है। इस भाग में तापमान अपेक्षाकृत कम होता है और यहाँ पर अधजले कार्बन कण उपस्थित होते हैं, जो काले धुएं के रूप में दिखाई देते हैं। इसलिए इसे आंशिक दहन का भाग कहा जाता है।

अब हम अन्य विकल्पों पर विचार करते हैं:

1. स्वतः: यह विकल्प गलत है क्योंकि "स्वतः दहन" का अर्थ होता है बिना किसी बाहरी स्रोत के स्वतः जलना। मोमबत्ती की ज्वाला का मध्य भाग स्वतः दहन का उदाहरण नहीं है।

2. तीव्र: यह विकल्प गलत है क्योंकि "तीव्र दहन" का अर्थ होता है तेजी से और पूरी तरह से जलना। ज्वाला का मध्य भाग तीव्र दहन का उदाहरण नहीं है क्योंकि यहाँ ऑक्सीजन की कमी के कारण दहन अधूरा होता है।

3. पूर्ण: यह विकल्प गलत है क्योंकि "पूर्ण दहन" का अर्थ होता है जब ईंधन पूरी तरह से जलकर कार्बन डाइऑक्साइड और पानी में परिवर्तित हो जाता है। ज्वाला के मध्य भाग में पूर्ण दहन नहीं होता है, इसलिए यह विकल्प सही नहीं है।

इस प्रकार, दिए गए विकल्पों में से "आंशिक" ही सही उत्तर है क्योंकि यह ज्वाला के मध्य भाग की दहन प्रक्रिया का सही वर्णन करता है।

Option 1 is correct because the outer zone of a flame is indeed its hottest part where complete combustion occurs. In a typical flame, such as that of a Bunsen burner, the outermost layer is exposed to the most oxygen, allowing for complete combustion of the fuel. This results in a higher temperature compared to other parts of the flame. The complete combustion in this zone produces a blue flame, which is an indicator of high temperature and efficient burning.

Now, let's examine why the other options are incorrect:

Option 2: The middle zone of the flame is not red-colored. In fact, the middle zone is typically yellow or orange due to incomplete combustion. This part of the flame is cooler than the outer zone and contains unburnt carbon particles that glow, giving it a yellowish color.

Option 3: The innermost zone of the flame is not moderately hot; it is actually the coolest part of the flame. This zone is where the fuel is initially heated and begins to vaporize, but there is insufficient oxygen for combustion to occur. As a result, it is cooler compared to the other zones.

Option 4: The innermost zone of the flame is not blue-colored. The blue color is characteristic of the outer zone where complete combustion takes place. The innermost zone is typically less visible and not blue because it lacks the conditions necessary for complete combustion.

In summary, Option 1 is correct because it accurately describes the outer zone of the flame as the hottest part where complete combustion occurs, while the other options incorrectly describe the characteristics of the different zones of a flame.

ज्वाला के विभिन्न क्षेत्रों के संदर्भ में दिए गए विकल्पों में से विकल्प 1 सही है: "ज्वाला का सबसे बाहरी क्षेत्र सबसे गर्म भाग होता है जहाँ पूर्ण दहन होता है।"

विस्तृत व्याख्या:

1. विकल्प 1: ज्वाला का सबसे बाहरी क्षेत्र सबसे गर्म भाग होता है जहाँ पूर्ण दहन होता है।

   • यह कथन सही है क्योंकि ज्वाला के सबसे बाहरी क्षेत्र में ऑक्सीजन की उपलब्धता अधिक होती है, जिससे पूर्ण दहन होता है। इस क्षेत्र में तापमान सबसे अधिक होता है, और यह नीले रंग का दिखाई देता है। पूर्ण दहन के कारण इस क्षेत्र में ऊर्जा का अधिकतम उत्पादन होता है, जिससे यह सबसे गर्म होता है।

2. विकल्प 2: ज्वाला का मध्य क्षेत्र लाल रंग का होता है।

   • यह कथन गलत है। ज्वाला का मध्य क्षेत्र आमतौर पर पीले या नारंगी रंग का होता है, न कि लाल। इस क्षेत्र में आंशिक दहन होता है, और तापमान बाहरी क्षेत्र की तुलना में कम होता है।

3. विकल्प 3: ज्वाला का सबसे अन्दर का क्षेत्र औसत (मध्यम) गर्म होता है।

   • यह कथन गलत है। ज्वाला का सबसे अन्दर का क्षेत्र वास्तव में सबसे ठंडा होता है क्योंकि यहाँ ऑक्सीजन की कमी होती है और दहन प्रक्रिया अधूरी होती है। इस क्षेत्र में तापमान सबसे कम होता है।

4. विकल्प 4: ज्वाला का सबसे अन्दर का क्षेत्र नीले रंग का होता है।

   • यह कथन गलत है। ज्वाला का सबसे अन्दर का क्षेत्र आमतौर पर काला या धुएँ के रंग का होता है, क्योंकि यहाँ दहन अधूरा होता है। नीला रंग ज्वाला के बाहरी क्षेत्र में देखा जाता है, जहाँ पूर्ण दहन होता है।

इस प्रकार, विकल्प 1 सही है क्योंकि यह ज्वाला के बाहरी क्षेत्र की विशेषताओं को सही ढंग से दर्शाता है, जहाँ पूर्ण दहन के कारण तापमान सबसे अधिक होता है।

Hydrogen is the correct answer because it has the highest calorific value among the given options. The calorific value of a fuel is the amount of energy released during its complete combustion. It is typically measured in units such as kilojoules per gram (kJ/g) or megajoules per kilogram (MJ/kg).

1. Hydrogen (Option 4): Hydrogen has an exceptionally high calorific value, approximately 120-142 MJ/kg. This is because hydrogen is a very light element and releases a significant amount of energy when it reacts with oxygen to form water. The high energy content per unit mass makes hydrogen an efficient fuel, especially for applications where weight is a critical factor, such as in aerospace.

2. Petrol (Option 1): Petrol, also known as gasoline, has a calorific value of about 44-47 MJ/kg. While it is a widely used fuel for internal combustion engines due to its energy density and ease of use, its calorific value is significantly lower than that of hydrogen.

3. LPG (Option 2): Liquefied Petroleum Gas (LPG) has a calorific value of approximately 46-50 MJ/kg. LPG is a mixture of propane and butane and is commonly used for heating, cooking, and in some vehicles. Although it has a higher calorific value than petrol, it still falls short compared to hydrogen.

4. CNG (Option 3): Compressed Natural Gas (CNG) has a calorific value of about 45-55 MJ/kg. CNG is primarily composed of methane and is used as a cleaner alternative to other fossil fuels. Despite its advantages in terms of emissions, its calorific value is lower than that of hydrogen.

In summary, hydrogen stands out as the fuel with the highest calorific value among the options provided. Its ability to release a large amount of energy per unit mass makes it the most efficient choice in terms of energy content, justifying why Option 4 is the correct answer.

हाइड्रोजन का अधिकतम कैलोरी मान होने का कारण यह है कि हाइड्रोजन एक अत्यधिक ऊर्जा घनत्व वाला ईंधन है। हाइड्रोजन का कैलोरी मान लगभग 120-142 मेगाजूल प्रति किलोग्राम होता है, जो इसे अन्य पारंपरिक ईंधनों की तुलना में अधिक ऊर्जा प्रदान करने में सक्षम बनाता है।

अब हम अन्य विकल्पों पर विचार करते हैं:

1. पेट्रोल: पेट्रोल का कैलोरी मान लगभग 44-46 मेगाजूल प्रति किलोग्राम होता है। यह हाइड्रोजन की तुलना में काफी कम है, इसलिए पेट्रोल अधिकतम कैलोरी मान वाला ईंधन नहीं है।

2. एलपीजी (लिक्विफाइड पेट्रोलियम गैस): एलपीजी का कैलोरी मान लगभग 46-50 मेगाजूल प्रति किलोग्राम होता है। यह भी हाइड्रोजन की तुलना में कम है, इसलिए एलपीजी अधिकतम कैलोरी मान वाला ईंधन नहीं है।

3. सीएनजी (कंप्रेस्ड नेचुरल गैस): सीएनजी का कैलोरी मान लगभग 50-55 मेगाजूल प्रति किलोग्राम होता है। यह भी हाइड्रोजन की तुलना में कम है, इसलिए सीएनजी अधिकतम कैलोरी मान वाला ईंधन नहीं है।

इस प्रकार, हाइड्रोजन का कैलोरी मान अन्य सभी विकल्पों की तुलना में सबसे अधिक है, जो इसे अधिकतम ऊर्जा प्रदान करने वाला ईंधन बनाता है। यही कारण है कि विकल्प 4 सही उत्तर है।

The correct sequence of the number of carbon atoms present in (a) compressed natural gas, (b) diesel, and (c) petrol is given as Option 2: b > c > a. Let's provide a detailed explanation to justify why this option is correct and why the other options are incorrect.

1. Explanation for Option 2 (Correct Answer: b > c > a):

   • Diesel (b): Diesel is a complex mixture of hydrocarbons, primarily consisting of alkanes with carbon chain lengths ranging from approximately C10 to C22. This means diesel has a relatively high number of carbon atoms compared to other fuels.

   • Petrol (c): Petrol, also known as gasoline, typically contains hydrocarbons with carbon chain lengths ranging from C4 to C12. This places petrol in the middle range in terms of the number of carbon atoms.

   • Compressed Natural Gas (a): Compressed natural gas (CNG) primarily consists of methane, which has only one carbon atom (CH4). Therefore, CNG has the lowest number of carbon atoms among the three.

   Based on the above information, the sequence b > c > a is correct because diesel has the highest number of carbon atoms, followed by petrol, and then compressed natural gas.

2. Explanation for why the other options are incorrect:

   • Option 1 (a > b > c): This option suggests that compressed natural gas has more carbon atoms than diesel and petrol, which is incorrect. CNG primarily consists of methane with only one carbon atom, making it the lowest in carbon content.

   • Option 3 (c > a > b): This option suggests that petrol has more carbon atoms than compressed natural gas and diesel, which is incorrect. While petrol has more carbon atoms than CNG, it has fewer than diesel.

   • Option 4 (a > c > b): This option suggests that compressed natural gas has more carbon atoms than petrol and diesel, which is incorrect. As previously mentioned, CNG has the least number of carbon atoms.

In conclusion, Option 2 (b > c > a) is the correct answer because it accurately reflects the order of the number of carbon atoms present in diesel, petrol, and compressed natural gas, respectively.

सीएनजी (CNG), डीजल, और पेट्रोल में उपस्थित कार्बन परमाणुओं की संख्या के सही क्रम को समझने के लिए हमें इन ईंधनों की रासायनिक संरचना पर ध्यान देना होगा।

1. डीजल (b): डीजल में कार्बन परमाणुओं की संख्या आमतौर पर 12 से 20 के बीच होती है। यह एक भारी हाइड्रोकार्बन है और इसमें लंबी कार्बन श्रृंखलाएं होती हैं।

2. पेट्रोल (c): पेट्रोल में कार्बन परमाणुओं की संख्या लगभग 5 से 12 के बीच होती है। यह डीजल की तुलना में हल्का होता है और इसमें छोटी कार्बन श्रृंखलाएं होती हैं।

3. सीएनजी (CNG) (a): सीएनजी मुख्य रूप से मीथेन (CH₄) से बना होता है, जिसमें केवल एक कार्बन परमाणु होता है।

अब, दिए गए विकल्पों के अनुसार:

• Option 2 (b > c > a): यह विकल्प सही है क्योंकि डीजल में सबसे अधिक कार्बन परमाणु होते हैं, उसके बाद पेट्रोल और अंत में सीएनजी में सबसे कम कार्बन परमाणु होते हैं। डीजल की लंबी कार्बन श्रृंखला इसे सबसे अधिक कार्बन युक्त बनाती है, जबकि सीएनजी में केवल एक कार्बन परमाणु होता है।

अन्य विकल्प क्यों गलत हैं:

• Option 1 (a > b > c): यह गलत है क्योंकि सीएनजी में सबसे कम कार्बन परमाणु होते हैं, जबकि इस विकल्प में इसे सबसे अधिक दिखाया गया है।

• Option 3 (c > a > b): यह गलत है क्योंकि डीजल में पेट्रोल से अधिक कार्बन परमाणु होते हैं, जबकि इस विकल्प में पेट्रोल को सबसे अधिक दिखाया गया है।

• Option 4 (a > c > b): यह गलत है क्योंकि सीएनजी में सबसे कम कार्बन परमाणु होते हैं, जबकि इस विकल्प में इसे सबसे अधिक दिखाया गया है।

इस प्रकार, Option 2 (b > c > a) सही है क्योंकि यह डीजल, पेट्रोल, और सीएनजी में कार्बन परमाणुओं की वास्तविक संख्या के क्रम को सही ढंग से दर्शाता है।

The correct answer is Option 2: Lignite.

1. Explanation for Option 2 (Lignite):

   • Lignite is a type of coal that is often referred to as "brown coal" due to its brownish-black color. It is considered the lowest rank of coal because it has the lowest carbon content, typically ranging from 60% to 70%. This low carbon content results in a lower energy density compared to higher-ranked coals.
   • Lignite has a high moisture content, which can be as much as 30% to 40%. This high moisture content makes it less efficient for combustion, but it is still widely used in power plants to produce electricity because it is abundant and relatively inexpensive to mine.
   • Due to its properties, lignite is primarily used in electricity generation, where it is burned in power plants to produce steam that drives turbines.

2. Explanation for why other options are incorrect:

   • Option 1 (Peat):

     • Peat is not classified as coal but rather as an accumulation of partially decayed vegetation or organic matter. It is the precursor to coal formation and has an even lower carbon content than lignite. Peat is not typically used in power plants for electricity generation on a large scale due to its low energy content and high moisture level.

   • Option 3 (Bituminous):

     • Bituminous coal is a higher rank of coal compared to lignite. It has a higher carbon content, typically between 77% and 87%, and a lower moisture content. Bituminous coal is more energy-dense and is commonly used for electricity generation, as well as in industrial processes such as steel production. Its properties make it more efficient for combustion than lignite.

   • Option 4 (Anthracite):

     • Anthracite is the highest rank of coal, with a carbon content of over 87% and very low moisture content. It is the most energy-dense form of coal and burns the cleanest, producing the most heat and the least smoke. Anthracite is not typically used in power plants for electricity generation due to its higher cost and limited availability compared to other types of coal.

In summary, lignite is the correct answer because it matches the description of a brown coal with low carbon content and high moisture content, commonly used in power plants for electricity generation. The other options do not fit this description due to differences in carbon content, moisture content, and typical uses.

भूरा कोयला, जिसे लिग्नाइट कहा जाता है, में कार्बन अवयव 60-70% होता है और यह उच्च नमी के साथ आता है। यह विशेष रूप से विद्युत उत्पन्न करने के लिए शक्ति संयंत्रों में उपयोग किया जाता है। लिग्नाइट कोयले का एक प्रकार है जो अपने भौतिक और रासायनिक गुणों के कारण इसे भूरा कोयला कहा जाता है। इसकी ऊर्जा उत्पादन क्षमता बिटुमिनस और ऐन्थ्रेसाइट की तुलना में कम होती है, लेकिन इसकी उपलब्धता और कम लागत के कारण इसे बिजली उत्पादन के लिए व्यापक रूप से उपयोग किया जाता है।

अब हम अन्य विकल्पों पर विचार करते हैं:

1. पीट: पीट कोयले का सबसे प्रारंभिक रूप है और इसमें कार्बन की मात्रा बहुत कम होती है। यह मुख्य रूप से अपघटित वनस्पति से बना होता है और इसे कोयले के रूप में नहीं माना जाता है। इसकी ऊर्जा उत्पादन क्षमता भी बहुत कम होती है।

2. बिटुमिनस: बिटुमिनस कोयला लिग्नाइट से अधिक परिपक्व होता है और इसमें कार्बन की मात्रा 77-87% होती है। यह लिग्नाइट की तुलना में अधिक ऊर्जा प्रदान करता है और इसका उपयोग औद्योगिक प्रक्रियाओं में अधिक होता है।

3. ऐन्थ्रेसाइट: ऐन्थ्रेसाइट कोयले का सबसे परिपक्व रूप है और इसमें कार्बन की मात्रा 87% से अधिक होती है। यह सबसे अधिक ऊर्जा प्रदान करता है और इसकी नमी की मात्रा बहुत कम होती है। यह लिग्नाइट की तुलना में अधिक महंगा और दुर्लभ होता है।

इस प्रकार, लिग्नाइट ही वह कोयला है जो भूरा कोयला कहलाता है और विद्युत उत्पादन के लिए शक्ति संयंत्रों में व्यापक रूप से उपयोग किया जाता है। यही कारण है कि विकल्प 2 सही उत्तर है।

Explanation:

1. Coke (Option 1): Coke is the correct answer because it is a crucial material used in the manufacturing of steel. Coke is a high-carbon product derived from coal through a process called destructive distillation. In steel production, coke serves as both a fuel and a reducing agent in the blast furnace. It provides the necessary heat to melt the iron ore and facilitates the chemical reactions needed to reduce iron oxide to iron. The carbon content in coke also helps in removing oxygen from the iron ore, which is essential for producing pure iron. Therefore, coke is indispensable in the steel manufacturing process.

2. Coal gas (Option 2): Coal gas is not used in the manufacturing of steel. It is a byproduct of the coal carbonization process and was historically used as a fuel for lighting and heating. While it can be used as a fuel source, it does not play a direct role in the chemical processes required for steel production, unlike coke.

3. Coaltar (Option 3): Coaltar is a byproduct obtained during the production of coke from coal. It is a thick, black liquid that is used in various applications such as roofing, waterproofing, and as a raw material for producing chemicals. However, it is not used in the steel manufacturing process itself. Its properties and applications are unrelated to the reduction of iron ore or the production of steel.

4. Bitumen (Option 4): Bitumen is a form of petroleum and is primarily used in road construction and roofing due to its adhesive and waterproofing properties. It is not involved in the steel manufacturing process. Bitumen does not have the necessary properties to act as a reducing agent or fuel in the blast furnace, making it unsuitable for steel production.

In summary, coke is the only option among the given choices that is directly involved in the steel manufacturing process, making it the correct answer.

स्टील के निर्माण में कोक का उपयोग होता है, इसलिए विकल्प 1 सही है। कोक एक उच्च कार्बन युक्त पदार्थ है जो कोयले को उच्च तापमान पर गर्म करके बनाया जाता है। यह स्टील निर्माण में एक महत्वपूर्ण भूमिका निभाता है क्योंकि यह लौह अयस्क को पिघलाने और उसमें से अशुद्धियों को हटाने में मदद करता है। कोक का उपयोग ब्लास्ट फर्नेस में किया जाता है, जहां यह लौह अयस्क के साथ प्रतिक्रिया करता है और इसे पिघलाकर स्टील में परिवर्तित करता है।

अब अन्य विकल्पों पर विचार करते हैं:

2. कोल गैस: कोल गैस एक गैसीय ईंधन है जो कोयले के गैसीकरण से प्राप्त होता है। इसका उपयोग मुख्य रूप से ऊर्जा उत्पादन और घरेलू ईंधन के रूप में होता है, न कि स्टील निर्माण में।

3. कोलतार: कोलतार एक गाढ़ा, काला तरल पदार्थ है जो कोयले के डिस्टिलेशन से प्राप्त होता है। इसका उपयोग मुख्य रूप से सड़क निर्माण और जलरोधक सामग्री के रूप में होता है, न कि स्टील निर्माण में।

4. बिटुमेन: बिटुमेन एक चिपचिपा, काला और अत्यधिक चिपचिपा पदार्थ है जो मुख्य रूप से सड़क निर्माण और छतों की जलरोधकता के लिए उपयोग किया जाता है। इसका स्टील निर्माण में कोई उपयोग नहीं है।

इस प्रकार, स्टील के निर्माण में कोक का उपयोग होता है, और यही कारण है कि विकल्प 1 सही है।